1-(3-FLUOROPHENYL)-4,4,4-TRIFLUOROBUTANE-1,3-DIONE structure
|
Common Name | 1-(3-FLUOROPHENYL)-4,4,4-TRIFLUOROBUTANE-1,3-DIONE | ||
|---|---|---|---|---|
| CAS Number | 23975-58-8 | Molecular Weight | 234.147 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 251.4±35.0 °C at 760 mmHg | |
| Molecular Formula | C10H6F4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 95.7±20.1 °C | |
| Name | 4,4,4-trifluoro-1-(3-fluorophenyl)butane-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 251.4±35.0 °C at 760 mmHg |
| Molecular Formula | C10H6F4O2 |
| Molecular Weight | 234.147 |
| Flash Point | 95.7±20.1 °C |
| Exact Mass | 234.030396 |
| PSA | 34.14000 |
| LogP | 4.27 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.449 |
| InChIKey | JRVIDAUJLHWEED-UHFFFAOYSA-N |
| SMILES | O=C(CC(=O)C(F)(F)F)c1cccc(F)c1 |
| HS Code | 2914700090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4,4,4-Trifluoro-1-(3-fluorophenyl)-1,3-butanedione |
| 4,4,4-Trifluoro-1-(3-fluorophenyl)butane-1,3-dione |
| 4,4,4-Trifluoro-1-(3-fluoro-phenyl)-butane-1,3-dione |
| 1-(3-Fluorophenyl)-4,4,4-trifluorobutane-1,3-dione |