Ethyl dirazepate structure
|
Common Name | Ethyl dirazepate | ||
|---|---|---|---|---|
| CAS Number | 23980-14-5 | Molecular Weight | 377.22100 | |
| Density | 1.42g/cm3 | Boiling Point | 532.7ºC at 760mmHg | |
| Molecular Formula | C18H14Cl2N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.9ºC | |
Use of Ethyl dirazepateEthyl dirazepate is a drug which is a benzodiazepine derivative. It has anxiolytic and hypnotic and possibly other characteristic benzodiazepine properties. |
| Name | ethyl 7-chloro-5-(2-chlorophenyl)-2-oxo-1,3-dihydro-1,4-benzodiazepine-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Description | Ethyl dirazepate is a drug which is a benzodiazepine derivative. It has anxiolytic and hypnotic and possibly other characteristic benzodiazepine properties. |
|---|---|
| Related Catalog | |
| Target |
Benzodiazepine[1] |
| References |
[1]. Demarne, Henri ,et al. Process for the preparation of 1,4-benzodiazepines. EP0022710A1 |
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 532.7ºC at 760mmHg |
| Molecular Formula | C18H14Cl2N2O3 |
| Molecular Weight | 377.22100 |
| Flash Point | 275.9ºC |
| Exact Mass | 376.03800 |
| PSA | 71.25000 |
| LogP | 3.23530 |
| Vapour Pressure | 2E-11mmHg at 25°C |
| Index of Refraction | 1.645 |
| InChIKey | XFVPZJMXRNBHLQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1N=C(c2ccccc2Cl)c2cc(Cl)ccc2NC1=O |
| Storage condition | 2-8℃ |
| UNII-74FAA305EW |
| 7-chloro-5-(2-chlorophenyl)-3-ethoxycarbonyl-2-oxo-2,3-dihydro-1H-1,4-benzodiazepine |
| 7-chloro-5-(2-chloro-phenyl)-2-oxo-2,3-dihydro-1H-benzo[e][1,4]diazepine-3-carboxylic acid ethyl ester |
| ethyl 7-chloro-5-(2-chlorophenyl)-2-oxo-2,3-dihydro-1h-1,4-benzodiazepine-3-carboxylate |
| Ethyl dirazepate [INN] |
| Ethyl dirazepate |