Lithium, [[3,5-bis[(dimethylamino)methyl]-4-iodophenyl]ethynyl]
Modify Date: 2026-07-03 17:35:51
![Lithium, [[3,5-bis[(dimethylamino)methyl]-4-iodophenyl]ethynyl] Structure](https://www.chemsrc.com/extcaspic/436/239809-75-7.png)
Lithium, [[3,5-bis[(dimethylamino)methyl]-4-iodophenyl]ethynyl] structure
|
Common Name | Lithium, [[3,5-bis[(dimethylamino)methyl]-4-iodophenyl]ethynyl] | ||
|---|---|---|---|---|
| CAS Number | 239809-75-7 | Molecular Weight | 348.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18ILiN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Lithium, [[3,5-bis[(dimethylamino)methyl]-4-iodophenyl]ethynyl] |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H18ILiN2 |
|---|---|
| Molecular Weight | 348.2 |
| InChIKey | WFFCNTNWNWIRTC-UHFFFAOYSA-N |
| SMILES | [C-]#Cc1cc(CN(C)C)c(I)c(CN(C)C)c1.[Li+] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Lithium, [[3,5-bis[(dimethylamino)methyl]-4-iodophenyl]ethynyl]? |
| A: Molecular formula of Lithium, [[3,5-bis[(dimethylamino)methyl]-4-iodophenyl]ethynyl] is C14H18ILiN2. |
| Q: What is the CAS number of Lithium, [[3,5-bis[(dimethylamino)methyl]-4-iodophenyl]ethynyl]? |
| A: CAS number of Lithium, [[3,5-bis[(dimethylamino)methyl]-4-iodophenyl]ethynyl] is 239809-75-7. |
| Q: What is the SMILES notation of Lithium, [[3,5-bis[(dimethylamino)methyl]-4-iodophenyl]ethynyl]? |
| A: SMILES notation of Lithium, [[3,5-bis[(dimethylamino)methyl]-4-iodophenyl]ethynyl] is [C-]#Cc1cc(CN(C)C)c(I)c(CN(C)C)c1.[Li+]. |
| Q: What is the InChIKey of Lithium, [[3,5-bis[(dimethylamino)methyl]-4-iodophenyl]ethynyl]? |
| A: InChIKey of Lithium, [[3,5-bis[(dimethylamino)methyl]-4-iodophenyl]ethynyl] is WFFCNTNWNWIRTC-UHFFFAOYSA-N. |
| Q: What is the molecular weight of Lithium, [[3,5-bis[(dimethylamino)methyl]-4-iodophenyl]ethynyl]? |
| A: Molecular weight of Lithium, [[3,5-bis[(dimethylamino)methyl]-4-iodophenyl]ethynyl] is 348.2. |
| Q: What is the Chinese name of 239809-75-7? |
| A: Chinese name of 239809-75-7 is 239809-75-7. |
| Q: What is the English name of Lithium, [[3,5-bis[(dimethylamino)methyl]-4-iodophenyl]ethynyl]? |
| A: The English name of Lithium, [[3,5-bis[(dimethylamino)methyl]-4-iodophenyl]ethynyl] is Lithium, [[3,5-bis[(dimethylamino)methyl]-4-iodophenyl]ethynyl]. |