Diclofenac Sodium and Misoprostol
Modify Date: 2025-08-31 18:20:32
Diclofenac Sodium and Misoprostol structure
|
Common Name | Diclofenac Sodium and Misoprostol | ||
|---|---|---|---|---|
| CAS Number | 239810-53-8 | Molecular Weight | 700.7 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C36H48Cl2NNaO7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Diclofenac Sodium and Misoprostol |
|---|
| Molecular Formula | C36H48Cl2NNaO7 |
|---|---|
| Molecular Weight | 700.7 |
| InChIKey | HDEFOQFNRFJUCB-ZJJFNMROSA-M |
| SMILES | CCCCC(C)(O)CC=CC1C(O)CC(=O)C1CCCCCCC(=O)OC.O=C([O-])Cc1ccccc1Nc1c(Cl)cccc1Cl.[Na+] |