7,8-Dihydroxy-4-(2-methoxyphenyl)-2H-1-benzopyran-2-one
Modify Date: 2026-07-18 10:09:01
7,8-Dihydroxy-4-(2-methoxyphenyl)-2H-1-benzopyran-2-one structure
|
Common Name | 7,8-Dihydroxy-4-(2-methoxyphenyl)-2H-1-benzopyran-2-one | ||
|---|---|---|---|---|
| CAS Number | 23982-28-7 | Molecular Weight | 284.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7,8-Dihydroxy-4-(2-methoxyphenyl)-2H-1-benzopyran-2-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H12O5 |
|---|---|
| Molecular Weight | 284.26 |
| InChIKey | IBIJNRXWTMONDM-UHFFFAOYSA-N |
| SMILES | COc1ccccc1-c1cc(=O)oc2c(O)c(O)ccc12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 7,8-Dihydroxy-4-(2-methoxyphenyl)-2H-1-benzopyran-2-one? |
| A: Molecular weight of 7,8-Dihydroxy-4-(2-methoxyphenyl)-2H-1-benzopyran-2-one is 284.26. |
| Q: What is the Chinese name of 23982-28-7? |
| A: Chinese name of 23982-28-7 is 23982-28-7. |
| Q: What is the English name of 7,8-Dihydroxy-4-(2-methoxyphenyl)-2H-1-benzopyran-2-one? |
| A: The English name of 7,8-Dihydroxy-4-(2-methoxyphenyl)-2H-1-benzopyran-2-one is 7,8-Dihydroxy-4-(2-methoxyphenyl)-2H-1-benzopyran-2-one. |
| Q: What is the molecular formula of 7,8-Dihydroxy-4-(2-methoxyphenyl)-2H-1-benzopyran-2-one? |
| A: Molecular formula of 7,8-Dihydroxy-4-(2-methoxyphenyl)-2H-1-benzopyran-2-one is C16H12O5. |
| Q: What is the SMILES notation of 7,8-Dihydroxy-4-(2-methoxyphenyl)-2H-1-benzopyran-2-one? |
| A: SMILES notation of 7,8-Dihydroxy-4-(2-methoxyphenyl)-2H-1-benzopyran-2-one is COc1ccccc1-c1cc(=O)oc2c(O)c(O)ccc12. |
| Q: What is the InChIKey of 7,8-Dihydroxy-4-(2-methoxyphenyl)-2H-1-benzopyran-2-one? |
| A: InChIKey of 7,8-Dihydroxy-4-(2-methoxyphenyl)-2H-1-benzopyran-2-one is IBIJNRXWTMONDM-UHFFFAOYSA-N. |
| Q: What is the CAS number of 7,8-Dihydroxy-4-(2-methoxyphenyl)-2H-1-benzopyran-2-one? |
| A: CAS number of 7,8-Dihydroxy-4-(2-methoxyphenyl)-2H-1-benzopyran-2-one is 23982-28-7. |