dimethyl 1,2,3,4-tetrahydronaphthalene-2,6-dicarboxylate
dimethyl 1,2,3,4-tetrahydronaphthalene-2,6-dicarboxylate structure
|
Common Name | dimethyl 1,2,3,4-tetrahydronaphthalene-2,6-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 23985-75-3 | Molecular Weight | 248.27400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: dimethyl 1,2,3,4-tetrahydronaphthalene-2,6-dicarboxylate (CAS: 23985-75-3, molecular formula: C14H16O4, molecular weight: 248.27400) For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | dimethyl 1,2,3,4-tetrahydronaphthalene-2,6-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H16O4 |
|---|---|
| Molecular Weight | 248.27400 |
| Exact Mass | 248.10500 |
| PSA | 52.60000 |
| LogP | 1.75110 |
| InChIKey | IGFALCDVZUTCGJ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc2c(c1)CCC(C(=O)OC)C2 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:97901-21-8This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| dimethyl 1,2,3-tetrahydronaphthalene-2,6-dicarboxylate |
| 2,6-Naphthalenedicarboxylic acid,1,2,3,4-tetrahydro-,dimethyl ester |
| 1,2,3,4-Tetrahydro-naphthalin-2,6-dicarbonsaeure-dimethylester |
| methyl 6-methoxycarbonyl-5,6,7,8-tetrahydronaphthalene-2-carboxylate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 23985-75-3? |
| A: Chinese name of 23985-75-3 is 23985-75-3. |
| Q: What is the SMILES notation of dimethyl 1,2,3,4-tetrahydronaphthalene-2,6-dicarboxylate? |
| A: SMILES notation of dimethyl 1,2,3,4-tetrahydronaphthalene-2,6-dicarboxylate is COC(=O)c1ccc2c(c1)CCC(C(=O)OC)C2. |
| Q: What is the molecular formula of dimethyl 1,2,3,4-tetrahydronaphthalene-2,6-dicarboxylate? |
| A: Molecular formula of dimethyl 1,2,3,4-tetrahydronaphthalene-2,6-dicarboxylate is C14H16O4. |
| Q: What is the English name of dimethyl 1,2,3,4-tetrahydronaphthalene-2,6-dicarboxylate? |
| A: The English name of dimethyl 1,2,3,4-tetrahydronaphthalene-2,6-dicarboxylate is dimethyl 1,2,3,4-tetrahydronaphthalene-2,6-dicarboxylate. |
| Q: What is the polar surface area (PSA) of dimethyl 1,2,3,4-tetrahydronaphthalene-2,6-dicarboxylate? |
| A: Polar surface area (PSA) of dimethyl 1,2,3,4-tetrahydronaphthalene-2,6-dicarboxylate is 52.60000. |
| Q: What is the CAS number of dimethyl 1,2,3,4-tetrahydronaphthalene-2,6-dicarboxylate? |
| A: CAS number of dimethyl 1,2,3,4-tetrahydronaphthalene-2,6-dicarboxylate is 23985-75-3. |
| Q: What is the LogP of dimethyl 1,2,3,4-tetrahydronaphthalene-2,6-dicarboxylate? |
| A: LogP of dimethyl 1,2,3,4-tetrahydronaphthalene-2,6-dicarboxylate is 1.75110. |
| Q: What English synonyms does dimethyl 1,2,3,4-tetrahydronaphthalene-2,6-dicarboxylate have? |
| A: English synonyms of dimethyl 1,2,3,4-tetrahydronaphthalene-2,6-dicarboxylate: dimethyl 1,2,3-tetrahydronaphthalene-2,6-dicarboxylate, 2,6-Naphthalenedicarboxylic acid,1,2,3,4-tetrahydro-,dimethyl ester, 1,2,3,4-Tetrahydro-naphthalin-2,6-dicarbonsaeure-dimethylester, methyl 6-methoxycarbonyl-5,6,7,8-tetrahydronaphthalene-2-carboxylate. |
| Q: What is the InChIKey of dimethyl 1,2,3,4-tetrahydronaphthalene-2,6-dicarboxylate? |
| A: InChIKey of dimethyl 1,2,3,4-tetrahydronaphthalene-2,6-dicarboxylate is IGFALCDVZUTCGJ-UHFFFAOYSA-N. |
| Q: What is the molecular weight of dimethyl 1,2,3,4-tetrahydronaphthalene-2,6-dicarboxylate? |
| A: Molecular weight of dimethyl 1,2,3,4-tetrahydronaphthalene-2,6-dicarboxylate is 248.27400. |