6H-benzo[h][1,6]naphthyridin-5-one
![6H-benzo[h][1,6]naphthyridin-5-one Structure](https://image.chemsrc.com/caspic/030/23985-95-7.png)
6H-benzo[h][1,6]naphthyridin-5-one structure
|
Common Name | 6H-benzo[h][1,6]naphthyridin-5-one | ||
|---|---|---|---|---|
| CAS Number | 23985-95-7 | Molecular Weight | 196.20500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 6H-benzo[h][1,6]naphthyridin-5-one (CAS number: 23985-95-7, molecular formula: C12H8N2O, molecular weight: 196.20500), for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6H-benzo[h][1,6]naphthyridin-5-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H8N2O |
|---|---|
| Molecular Weight | 196.20500 |
| Exact Mass | 196.06400 |
| PSA | 46.01000 |
| LogP | 2.48860 |
| InChIKey | JMTLQELGMAHUEB-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c2ccccc2c2ncccc12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 8 | |
|---|---|
| DownStream 1 | |
CAS#:868944-69-8
CAS#:115377-94-1
CAS#:1452-94-4
CAS#:6602-54-6
CAS#:1993-03-9
CAS#:1575-61-7
CAS#:1885-29-6
CAS#:2942-59-8![5-chlorobenzo[h][1,6]naphthyridine structure](https://image.chemsrc.com/caspic/492/23985-96-8.png)
CAS#:23985-96-8This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Inhibitory activity against Poly (ADP-ribose) polymerase 1
Source: ChEMBL
Target: Poly [ADP-ribose] polymerase 1
External Id: CHEMBL761610
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Benzo[h]-1,6-naphthyridin-5(6H)-one |
| benzo[c][2,5]naphthyridin-1(2H)-one |
| 6H-1,6-Phenanthrolin-5-on |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 6H-benzo[h][1,6]naphthyridin-5-one? |
| A: Polar surface area (PSA) of 6H-benzo[h][1,6]naphthyridin-5-one is 46.01000. |
| Q: What is the molecular formula of 6H-benzo[h][1,6]naphthyridin-5-one? |
| A: Molecular formula of 6H-benzo[h][1,6]naphthyridin-5-one is C12H8N2O. |
| Q: What is the molecular weight of 6H-benzo[h][1,6]naphthyridin-5-one? |
| A: Molecular weight of 6H-benzo[h][1,6]naphthyridin-5-one is 196.20500. |
| Q: What is the SMILES notation of 6H-benzo[h][1,6]naphthyridin-5-one? |
| A: SMILES notation of 6H-benzo[h][1,6]naphthyridin-5-one is O=c1[nH]c2ccccc2c2ncccc12. |
| Q: What is the LogP of 6H-benzo[h][1,6]naphthyridin-5-one? |
| A: LogP of 6H-benzo[h][1,6]naphthyridin-5-one is 2.48860. |
| Q: What is the CAS number of 6H-benzo[h][1,6]naphthyridin-5-one? |
| A: CAS number of 6H-benzo[h][1,6]naphthyridin-5-one is 23985-95-7. |
| Q: What is the InChIKey of 6H-benzo[h][1,6]naphthyridin-5-one? |
| A: InChIKey of 6H-benzo[h][1,6]naphthyridin-5-one is JMTLQELGMAHUEB-UHFFFAOYSA-N. |
| Q: What are the downstream products of 6H-benzo[h][1,6]naphthyridin-5-one? |
| A: Related downstream products(CAS) of 6H-benzo[h][1,6]naphthyridin-5-one: 23985-96-8. |
| Q: What is the Chinese name of 23985-95-7? |
| A: Chinese name of 23985-95-7 is 23985-95-7. |
| Q: What is the English name of 6H-benzo[h][1,6]naphthyridin-5-one? |
| A: The English name of 6H-benzo[h][1,6]naphthyridin-5-one is 6H-benzo[h][1,6]naphthyridin-5-one. |