Ethylphosphonodithioic acid O-ethyl S-[(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)methyl] ester structure
|
Common Name | Ethylphosphonodithioic acid O-ethyl S-[(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)methyl] ester | ||
|---|---|---|---|---|
| CAS Number | 24017-24-1 | Molecular Weight | 329.37500 | |
| Density | 1.36g/cm3 | Boiling Point | 436ºC at 760mmHg | |
| Molecular Formula | C13H16NO3PS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.5ºC | |
| Name | 2-[[ethoxy(ethyl)phosphinothioyl]sulfanylmethyl]isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 436ºC at 760mmHg |
| Molecular Formula | C13H16NO3PS2 |
| Molecular Weight | 329.37500 |
| Flash Point | 217.5ºC |
| Exact Mass | 329.03100 |
| PSA | 113.81000 |
| LogP | 3.92770 |
| Vapour Pressure | 8.36E-08mmHg at 25°C |
| Index of Refraction | 1.617 |
| InChIKey | MRNTWTRUPWODMD-UHFFFAOYSA-N |
| SMILES | CCOP(=S)(CC)SCN1C(=O)c2ccccc2C1=O |
| HS Code | 2930909027 |
|---|
| HS Code | 2930909027 |
|---|---|
| Summary | 2930909027 。supervision conditions:23(import license for dual-use item and technologies,export license for dual-use item and technologies)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| s-[(1,3-dioxo-1,3-dihydro-2h-isoindol-2-yl)methyl] o-ethyl ethylphosphonodithioate |
| N-(Mercaptomethyl)phthalimide-S-(O-ethyl)-ethylphosphonodithioate |
| Phosphonodithioic acid,ethyl-,O-ethyl ester,S-ester with N-(mercaptomethyl)phthalimide |
| O-Ethyl-S-(phthalimidomethyl)-ethylphosphonodithioate |
| Guaiphensin carbamate |