Benzenemethanol,3-nitro-a,a-bis(trifluoromethyl)
Benzenemethanol,3-nitro-a,a-bis(trifluoromethyl) structure
|
Common Name | Benzenemethanol,3-nitro-a,a-bis(trifluoromethyl) | ||
|---|---|---|---|---|
| CAS Number | 2402-65-5 | Molecular Weight | 289.13100 | |
| Density | 1.59g/cm3 | Boiling Point | 290.4ºC at 760 mmHg | |
| Molecular Formula | C9H5F6NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 129.4ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,1,1,3,3,3-hexafluoro-2-(3-nitrophenyl)propan-2-ol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.59g/cm3 |
|---|---|
| Boiling Point | 290.4ºC at 760 mmHg |
| Molecular Formula | C9H5F6NO3 |
| Molecular Weight | 289.13100 |
| Flash Point | 129.4ºC |
| Exact Mass | 289.01700 |
| PSA | 66.05000 |
| LogP | 3.43020 |
| Vapour Pressure | 0.000957mmHg at 25°C |
| Index of Refraction | 1.451 |
| InChIKey | RAABHVDDVYONFB-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(C(O)(C(F)(F)F)C(F)(F)F)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~92%
Benzenemethanol... CAS#:2402-65-5 |
| Literature: Li, Leping; Liu, Jiwen; Zhu, Liusheng; Cutler, Serena; Hasegawa, Hirohiko; Shan, Bei; Medina, Julio C. Bioorganic and Medicinal Chemistry Letters, 2006 , vol. 16, # 6 p. 1638 - 1642 |
|
~%
Benzenemethanol... CAS#:2402-65-5 |
| Literature: Sheppard,W.A. Journal of the American Chemical Society, 1965 , vol. 87, # 11 p. 2410 - 2420 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:2402-67-7This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-[2,2,2-trifluoro-1-hydroxy-1-(trifluoromethyl)ethyl]-3-nitrobenzene |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1,1,1,3,3,3-hexafluoro-2-(3-nitrophenyl)propan-2-ol? |
| A: Molecular weight of 1,1,1,3,3,3-hexafluoro-2-(3-nitrophenyl)propan-2-ol is 289.13100. |
| Q: What is the CAS number of 1,1,1,3,3,3-hexafluoro-2-(3-nitrophenyl)propan-2-ol? |
| A: CAS number of 1,1,1,3,3,3-hexafluoro-2-(3-nitrophenyl)propan-2-ol is 2402-65-5. |
| Q: What is the molecular formula of 1,1,1,3,3,3-hexafluoro-2-(3-nitrophenyl)propan-2-ol? |
| A: Molecular formula of 1,1,1,3,3,3-hexafluoro-2-(3-nitrophenyl)propan-2-ol is C9H5F6NO3. |
| Q: What is the LogP of 1,1,1,3,3,3-hexafluoro-2-(3-nitrophenyl)propan-2-ol? |
| A: LogP of 1,1,1,3,3,3-hexafluoro-2-(3-nitrophenyl)propan-2-ol is 3.43020. |
| Q: What are the downstream products of 1,1,1,3,3,3-hexafluoro-2-(3-nitrophenyl)propan-2-ol? |
| A: Related downstream products(CAS) of 1,1,1,3,3,3-hexafluoro-2-(3-nitrophenyl)propan-2-ol: 2402-67-7. |
| Q: What is the English name of 1,1,1,3,3,3-hexafluoro-2-(3-nitrophenyl)propan-2-ol? |
| A: The English name of 1,1,1,3,3,3-hexafluoro-2-(3-nitrophenyl)propan-2-ol is 1,1,1,3,3,3-hexafluoro-2-(3-nitrophenyl)propan-2-ol. |
| Q: What is the SMILES notation of 1,1,1,3,3,3-hexafluoro-2-(3-nitrophenyl)propan-2-ol? |
| A: SMILES notation of 1,1,1,3,3,3-hexafluoro-2-(3-nitrophenyl)propan-2-ol is O=[N+]([O-])c1cccc(C(O)(C(F)(F)F)C(F)(F)F)c1. |
| Q: What English synonyms does 1,1,1,3,3,3-hexafluoro-2-(3-nitrophenyl)propan-2-ol have? |
| A: English synonyms of 1,1,1,3,3,3-hexafluoro-2-(3-nitrophenyl)propan-2-ol: 1-[2,2,2-trifluoro-1-hydroxy-1-(trifluoromethyl)ethyl]-3-nitrobenzene. |
| Q: What is the polar surface area (PSA) of 1,1,1,3,3,3-hexafluoro-2-(3-nitrophenyl)propan-2-ol? |
| A: Polar surface area (PSA) of 1,1,1,3,3,3-hexafluoro-2-(3-nitrophenyl)propan-2-ol is 66.05000. |
| Q: What is the boiling point of 1,1,1,3,3,3-hexafluoro-2-(3-nitrophenyl)propan-2-ol? |
| A: Boiling point of 1,1,1,3,3,3-hexafluoro-2-(3-nitrophenyl)propan-2-ol is 290.4ºC at 760 mmHg. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |