Benzenemethanol,3-nitro-a,a-bis(trifluoromethyl) structure
|
Common Name | Benzenemethanol,3-nitro-a,a-bis(trifluoromethyl) | ||
|---|---|---|---|---|
| CAS Number | 2402-65-5 | Molecular Weight | 289.13100 | |
| Density | 1.59g/cm3 | Boiling Point | 290.4ºC at 760 mmHg | |
| Molecular Formula | C9H5F6NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 129.4ºC | |
| Name | 1,1,1,3,3,3-hexafluoro-2-(3-nitrophenyl)propan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.59g/cm3 |
|---|---|
| Boiling Point | 290.4ºC at 760 mmHg |
| Molecular Formula | C9H5F6NO3 |
| Molecular Weight | 289.13100 |
| Flash Point | 129.4ºC |
| Exact Mass | 289.01700 |
| PSA | 66.05000 |
| LogP | 3.43020 |
| Vapour Pressure | 0.000957mmHg at 25°C |
| Index of Refraction | 1.451 |
| InChIKey | RAABHVDDVYONFB-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(C(O)(C(F)(F)F)C(F)(F)F)c1 |
|
~92%
Benzenemethanol... CAS#:2402-65-5 |
| Literature: Li, Leping; Liu, Jiwen; Zhu, Liusheng; Cutler, Serena; Hasegawa, Hirohiko; Shan, Bei; Medina, Julio C. Bioorganic and Medicinal Chemistry Letters, 2006 , vol. 16, # 6 p. 1638 - 1642 |
|
~%
Benzenemethanol... CAS#:2402-65-5 |
| Literature: Sheppard,W.A. Journal of the American Chemical Society, 1965 , vol. 87, # 11 p. 2410 - 2420 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 1-[2,2,2-trifluoro-1-hydroxy-1-(trifluoromethyl)ethyl]-3-nitrobenzene |