3-NITROPYRIDINE1-OXIDE structure
|
Common Name | 3-NITROPYRIDINE1-OXIDE | ||
|---|---|---|---|---|
| CAS Number | 2403-01-2 | Molecular Weight | 140.09700 | |
| Density | 1.43g/cm3 | Boiling Point | 397.2ºC at 760mmHg | |
| Molecular Formula | C5H4N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194ºC | |
| Name | 3-nitro-1-oxidopyridin-1-ium |
|---|---|
| Synonym | More Synonyms |
| Density | 1.43g/cm3 |
|---|---|
| Boiling Point | 397.2ºC at 760mmHg |
| Molecular Formula | C5H4N2O3 |
| Molecular Weight | 140.09700 |
| Flash Point | 194ºC |
| Exact Mass | 140.02200 |
| PSA | 71.28000 |
| LogP | 1.54650 |
| Vapour Pressure | 3.7E-06mmHg at 25°C |
| Index of Refraction | 1.601 |
| InChIKey | NJHMJTZPDXWLCV-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc[n+]([O-])c1 |
| HS Code | 2933399090 |
|---|
|
~18%
3-NITROPYRIDINE... CAS#:2403-01-2 |
| Literature: Vamos, Mitchell; Cosford, Nicholas D. P. Journal of Organic Chemistry, 2014 , vol. 79, # 5 p. 2274 - 2280 |
|
~70%
3-NITROPYRIDINE... CAS#:2403-01-2 |
| Literature: Achremowicz, Lucjan Tetrahedron Letters, 1980 , vol. 21, p. 2433 - 2434 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-nitropyridine N-oxide |
| 3-nitropyridine oxide |
| 3-nitraminopyridine N-oxide |
| 3-Nitropyridine 1-oxide |
| Pyridine,3-nitro-,1-oxide |
| 3-Nitro-pyridin-oxid-(1) |
| 3-Nitro-pyridin-1-oxid |