1(2H)-Phthalazinone,1-phthalazinylhydrazone (9CI) structure
|
Common Name | 1(2H)-Phthalazinone,1-phthalazinylhydrazone (9CI) | ||
|---|---|---|---|---|
| CAS Number | 24030-07-7 | Molecular Weight | 288.30700 | |
| Density | 1.46g/cm3 | Boiling Point | 565.8ºC at 760mmHg | |
| Molecular Formula | C16H12N6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 296ºC | |
| Name | 1-(2-Phthalazin-1-ylhydrazino)phthalazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 565.8ºC at 760mmHg |
| Molecular Formula | C16H12N6 |
| Molecular Weight | 288.30700 |
| Flash Point | 296ºC |
| Exact Mass | 288.11200 |
| PSA | 82.08000 |
| LogP | 1.85580 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.764 |
| InChIKey | ITXSXNARZIEBGB-UHFFFAOYSA-N |
| SMILES | c1ccc2c(NNc3nncc4ccccc34)nncc2c1 |
| HS Code | 2933990090 |
|---|
|
~%
1(2H)-Phthalazi... CAS#:24030-07-7 |
| Literature: Druey; Ringier Helvetica Chimica Acta, 1951 , vol. 34, p. 195,204 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,2-di(phthalazin-1-yl)hydrazine |