1-(alpha-(2-piperidinioethoxycarbonyl)benzyl)piperidinium dichloride structure
|
Common Name | 1-(alpha-(2-piperidinioethoxycarbonyl)benzyl)piperidinium dichloride | ||
|---|---|---|---|---|
| CAS Number | 2404-18-4 | Molecular Weight | 403.38600 | |
| Density | N/A | Boiling Point | 449ºC at 760 mmHg | |
| Molecular Formula | C20H32Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.4ºC | |
Use of 1-(alpha-(2-piperidinioethoxycarbonyl)benzyl)piperidinium dichlorideDipiproverine (hydrochloride) is the hydrochloride form of Dipiproverine (HY-118524). Dipiproverine (hydrochloride) is an alpha-amino acid ester, an antispasmodic compound, which is used as an anticholinergic agent[1]. |
| Name | 2-piperidin-1-ylethyl 2-phenyl-2-piperidin-1-ylacetate,dihydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | Dipiproverine (hydrochloride) is the hydrochloride form of Dipiproverine (HY-118524). Dipiproverine (hydrochloride) is an alpha-amino acid ester, an antispasmodic compound, which is used as an anticholinergic agent[1]. |
|---|---|
| Related Catalog | |
| References |
| Boiling Point | 449ºC at 760 mmHg |
|---|---|
| Molecular Formula | C20H32Cl2N2O2 |
| Molecular Weight | 403.38600 |
| Flash Point | 225.4ºC |
| Exact Mass | 402.18400 |
| PSA | 32.78000 |
| LogP | 4.72250 |
| Vapour Pressure | 2.96E-08mmHg at 25°C |
| InChIKey | CBACFHTXHGHTMH-UHFFFAOYSA-N |
| SMILES | O=C(OCC[NH+]1CCCCC1)C(c1ccccc1)[NH+]1CCCCC1.[Cl-].[Cl-] |
| Dichlorhydrate de dipiproverine [French] |
| phenyl-piperidino-acetic acid-(2-piperidino-ethyl ester),dihydrochloride |
| L.D. 935 |
| Dipiproverine hydrochloride |
| Phenyl-piperidino-essigsaeure-(2-piperidino-aethylester),Dihydrochlorid |
| EINECS 219-293-3 |
| 2-(1-piperidinyl)ethyl ester,dihydrochloride |
| Dipiproverine dihydrochloride |
| Spasmonal |
| Dipiproverine HCl |
| Levospasme |