ethyl 5-hydroxy-6-methyl-4-oxopyran-2-carboxylate structure
|
Common Name | ethyl 5-hydroxy-6-methyl-4-oxopyran-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 24056-48-2 | Molecular Weight | 198.17300 | |
| Density | 1.36g/cm3 | Boiling Point | 362.7ºC at 760 mmHg | |
| Molecular Formula | C9H10O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.3ºC | |
| Name | ethyl 5-hydroxy-6-methyl-4-oxopyran-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 362.7ºC at 760 mmHg |
| Molecular Formula | C9H10O5 |
| Molecular Weight | 198.17300 |
| Flash Point | 147.3ºC |
| Exact Mass | 198.05300 |
| PSA | 76.74000 |
| LogP | 0.83050 |
| Vapour Pressure | 9.98E-07mmHg at 25°C |
| Index of Refraction | 1.542 |
| InChIKey | LXHGALLQKKIMAZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(=O)c(O)c(C)o1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-hydroxy-6-methyl-4-oxo-4H-pyran-2-carboxylic acid ethyl ester |
| 6-(Carboaethoxy)maltol |
| 3-Hydroxy-2-methyl-4-oxopyran-6-carboxylic-acid-ethylester |
| 4H-Pyran-2-carboxylicacid,5-hydroxy-6-methyl-4-oxo-,ethyl ester |
| 2-Methyl-3-hydroxy-6-carbethoxy-4-pyron |
| Ethyl 5-hydroxy-6-methyl-4-oxo-4H-pyran-2-carboxylate |