US11078228, Example 154
Modify Date: 2026-06-27 09:45:41
US11078228, Example 154 structure
|
Common Name | US11078228, Example 154 | ||
|---|---|---|---|---|
| CAS Number | 2407358-19-2 | Molecular Weight | 630.0 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H28ClN7O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | US11078228, Example 154 |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C27H28ClN7O9 |
|---|---|
| Molecular Weight | 630.0 |
| InChIKey | JEGJWEFJENBBEM-AZTDZYQASA-N |
| SMILES | CN1CCN(C(=O)C1)C2=CC=C(C=C2)CC(C(=O)O)(C(=O)O)OC[C@@H]3[C@@]([C@H]([C@@H](O3)N4C=NC5=C(N=C(N=C54)Cl)N)O)(C#C)O |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Inhibition of the CD73 Enzyme In Vitro from US Patent US11078228: "Ectonucleotidase i...
Source: BindingDB
Target: N/A
External Id: BindingDB_10055_1
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of US11078228, Example 154? |
| A: Molecular formula of US11078228, Example 154 is C27H28ClN7O9. |
| Q: What is the CAS number of US11078228, Example 154? |
| A: CAS number of US11078228, Example 154 is 2407358-19-2. |
| Q: What is the InChIKey of US11078228, Example 154? |
| A: InChIKey of US11078228, Example 154 is JEGJWEFJENBBEM-AZTDZYQASA-N. |
| Q: What is the SMILES notation of US11078228, Example 154? |
| A: SMILES notation of US11078228, Example 154 is CN1CCN(C(=O)C1)C2=CC=C(C=C2)CC(C(=O)O)(C(=O)O)OC[C@@H]3[C@@]([C@H]([C@@H](O3)N4C=NC5=C(N=C(N=C54)Cl)N)O)(C#C)O. |
| Q: What is the molecular weight of US11078228, Example 154? |
| A: Molecular weight of US11078228, Example 154 is 630.0. |
| Q: What is the Chinese name of 2407358-19-2? |
| A: Chinese name of 2407358-19-2 is 2407358-19-2. |
| Q: What is the English name of US11078228, Example 154? |
| A: The English name of US11078228, Example 154 is US11078228, Example 154. |