US11078228, Example 154
Modify Date: 2026-04-11 02:23:20
US11078228, Example 154 structure
|
Common Name | US11078228, Example 154 | ||
|---|---|---|---|---|
| CAS Number | 2407358-19-2 | Molecular Weight | 630.0 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H28ClN7O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | US11078228, Example 154 |
|---|
| Molecular Formula | C27H28ClN7O9 |
|---|---|
| Molecular Weight | 630.0 |
| InChIKey | JEGJWEFJENBBEM-AZTDZYQASA-N |
| SMILES | CN1CCN(C(=O)C1)C2=CC=C(C=C2)CC(C(=O)O)(C(=O)O)OC[C@@H]3[C@@]([C@H]([C@@H](O3)N4C=NC5=C(N=C(N=C54)Cl)N)O)(C#C)O |
|
Name: Inhibition of the CD73 Enzyme In Vitro from US Patent US11078228: "Ectonucleotidase i...
Source: BindingDB
Target: N/A
External Id: BindingDB_10055_1
|
Total 1, Current Page 1 of 1
1