Bempedoic acid impurity 1-d4 structure
|
Common Name | Bempedoic acid impurity 1-d4 | ||
|---|---|---|---|---|
| CAS Number | 2408132-01-2 | Molecular Weight | 346.49 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H30D4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Bempedoic acid impurity 1-d4Bempedoic acid impurity 1-d4 is the deuterium labeled Bempedoic acid impurity 1[1]. |
| Name | Bempedoic acid impurity 1-d4 |
|---|
| Description | Bempedoic acid impurity 1-d4 is the deuterium labeled Bempedoic acid impurity 1[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C19H30D4O5 |
|---|---|
| Molecular Weight | 346.49 |
| InChIKey | NHVXRVOYVVPVDU-AREBVXNXSA-N |
| SMILES | CC(C)(CCCCCC(=O)CCCCCC(C)(C)C(=O)O)C(=O)O |