rac-tert-butyl N-{2-[(1R,2S)-2-hydroxycyclopentyl]ethyl}carbamate
Modify Date: 2026-08-12 12:14:50
![rac-tert-butyl N-{2-[(1R,2S)-2-hydroxycyclopentyl]ethyl}carbamate Structure](https://www.chemsrc.com/extcaspic/052/2408937-77-7.png)
rac-tert-butyl N-{2-[(1R,2S)-2-hydroxycyclopentyl]ethyl}carbamate structure
|
Common Name | rac-tert-butyl N-{2-[(1R,2S)-2-hydroxycyclopentyl]ethyl}carbamate | ||
|---|---|---|---|---|
| CAS Number | 2408937-77-7 | Molecular Weight | 229.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H23NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | rac-tert-butyl N-{2-[(1R,2S)-2-hydroxycyclopentyl]ethyl}carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H23NO3 |
|---|---|
| Molecular Weight | 229.32 |
| InChIKey | AOBLEPGDFKPICD-VHSXEESVSA-N |
| SMILES | CC(C)(C)OC(=O)NCCC1CCCC1O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of rac-tert-butyl N-{2-[(1R,2S)-2-hydroxycyclopentyl]ethyl}carbamate? |
| A: CAS number of rac-tert-butyl N-{2-[(1R,2S)-2-hydroxycyclopentyl]ethyl}carbamate is 2408937-77-7. |
| Q: What is the molecular formula of rac-tert-butyl N-{2-[(1R,2S)-2-hydroxycyclopentyl]ethyl}carbamate? |
| A: Molecular formula of rac-tert-butyl N-{2-[(1R,2S)-2-hydroxycyclopentyl]ethyl}carbamate is C12H23NO3. |
| Q: What is the InChIKey of rac-tert-butyl N-{2-[(1R,2S)-2-hydroxycyclopentyl]ethyl}carbamate? |
| A: InChIKey of rac-tert-butyl N-{2-[(1R,2S)-2-hydroxycyclopentyl]ethyl}carbamate is AOBLEPGDFKPICD-VHSXEESVSA-N. |
| Q: What is the molecular weight of rac-tert-butyl N-{2-[(1R,2S)-2-hydroxycyclopentyl]ethyl}carbamate? |
| A: Molecular weight of rac-tert-butyl N-{2-[(1R,2S)-2-hydroxycyclopentyl]ethyl}carbamate is 229.32. |
| Q: What is the Chinese name of 2408937-77-7? |
| A: Chinese name of 2408937-77-7 is 2408937-77-7. |
| Q: What is the SMILES notation of rac-tert-butyl N-{2-[(1R,2S)-2-hydroxycyclopentyl]ethyl}carbamate? |
| A: SMILES notation of rac-tert-butyl N-{2-[(1R,2S)-2-hydroxycyclopentyl]ethyl}carbamate is CC(C)(C)OC(=O)NCCC1CCCC1O. |
| Q: What is the English name of rac-tert-butyl N-{2-[(1R,2S)-2-hydroxycyclopentyl]ethyl}carbamate? |
| A: The English name of rac-tert-butyl N-{2-[(1R,2S)-2-hydroxycyclopentyl]ethyl}carbamate is rac-tert-butyl N-{2-[(1R,2S)-2-hydroxycyclopentyl]ethyl}carbamate. |