4-Methyl-2-[(pyridin-4-yl)carbamoyl]phenyl sulfurofluoridate
Modify Date: 2026-07-11 00:29:21
![4-Methyl-2-[(pyridin-4-yl)carbamoyl]phenyl sulfurofluoridate Structure](https://www.chemsrc.com/extcaspic/304/2411229-93-9.png)
4-Methyl-2-[(pyridin-4-yl)carbamoyl]phenyl sulfurofluoridate structure
|
Common Name | 4-Methyl-2-[(pyridin-4-yl)carbamoyl]phenyl sulfurofluoridate | ||
|---|---|---|---|---|
| CAS Number | 2411229-93-9 | Molecular Weight | 310.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11FN2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Methyl-2-[(pyridin-4-yl)carbamoyl]phenyl sulfurofluoridate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H11FN2O4S |
|---|---|
| Molecular Weight | 310.30 |
| InChIKey | RPBQSMWPVDSZRD-UHFFFAOYSA-N |
| SMILES | Cc1ccc(OS(=O)(=O)F)c(C(=O)Nc2ccncc2)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 4-Methyl-2-[(pyridin-4-yl)carbamoyl]phenyl sulfurofluoridate? |
| A: The English name of 4-Methyl-2-[(pyridin-4-yl)carbamoyl]phenyl sulfurofluoridate is 4-Methyl-2-[(pyridin-4-yl)carbamoyl]phenyl sulfurofluoridate. |
| Q: What is the molecular weight of 4-Methyl-2-[(pyridin-4-yl)carbamoyl]phenyl sulfurofluoridate? |
| A: Molecular weight of 4-Methyl-2-[(pyridin-4-yl)carbamoyl]phenyl sulfurofluoridate is 310.30. |
| Q: What is the CAS number of 4-Methyl-2-[(pyridin-4-yl)carbamoyl]phenyl sulfurofluoridate? |
| A: CAS number of 4-Methyl-2-[(pyridin-4-yl)carbamoyl]phenyl sulfurofluoridate is 2411229-93-9. |
| Q: What is the SMILES notation of 4-Methyl-2-[(pyridin-4-yl)carbamoyl]phenyl sulfurofluoridate? |
| A: SMILES notation of 4-Methyl-2-[(pyridin-4-yl)carbamoyl]phenyl sulfurofluoridate is Cc1ccc(OS(=O)(=O)F)c(C(=O)Nc2ccncc2)c1. |
| Q: What is the InChIKey of 4-Methyl-2-[(pyridin-4-yl)carbamoyl]phenyl sulfurofluoridate? |
| A: InChIKey of 4-Methyl-2-[(pyridin-4-yl)carbamoyl]phenyl sulfurofluoridate is RPBQSMWPVDSZRD-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 4-Methyl-2-[(pyridin-4-yl)carbamoyl]phenyl sulfurofluoridate? |
| A: Molecular formula of 4-Methyl-2-[(pyridin-4-yl)carbamoyl]phenyl sulfurofluoridate is C13H11FN2O4S. |
| Q: What is the Chinese name of 2411229-93-9? |
| A: Chinese name of 2411229-93-9 is 2411229-93-9. |