2-Ethoxynaphthalen-1-yl sulfurofluoridate
Modify Date: 2026-08-05 18:28:45
2-Ethoxynaphthalen-1-yl sulfurofluoridate structure
|
Common Name | 2-Ethoxynaphthalen-1-yl sulfurofluoridate | ||
|---|---|---|---|---|
| CAS Number | 2411275-61-9 | Molecular Weight | 270.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H11FO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Ethoxynaphthalen-1-yl sulfurofluoridate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H11FO4S |
|---|---|
| Molecular Weight | 270.28 |
| InChIKey | CMSFOXCXFWYJFM-UHFFFAOYSA-N |
| SMILES | CCOc1ccc2ccccc2c1OS(=O)(=O)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2-Ethoxynaphthalen-1-yl sulfurofluoridate? |
| A: Molecular weight of 2-Ethoxynaphthalen-1-yl sulfurofluoridate is 270.28. |
| Q: What is the molecular formula of 2-Ethoxynaphthalen-1-yl sulfurofluoridate? |
| A: Molecular formula of 2-Ethoxynaphthalen-1-yl sulfurofluoridate is C12H11FO4S. |
| Q: What is the InChIKey of 2-Ethoxynaphthalen-1-yl sulfurofluoridate? |
| A: InChIKey of 2-Ethoxynaphthalen-1-yl sulfurofluoridate is CMSFOXCXFWYJFM-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2411275-61-9? |
| A: Chinese name of 2411275-61-9 is 2411275-61-9. |
| Q: What is the CAS number of 2-Ethoxynaphthalen-1-yl sulfurofluoridate? |
| A: CAS number of 2-Ethoxynaphthalen-1-yl sulfurofluoridate is 2411275-61-9. |
| Q: What is the English name of 2-Ethoxynaphthalen-1-yl sulfurofluoridate? |
| A: The English name of 2-Ethoxynaphthalen-1-yl sulfurofluoridate is 2-Ethoxynaphthalen-1-yl sulfurofluoridate. |
| Q: What is the SMILES notation of 2-Ethoxynaphthalen-1-yl sulfurofluoridate? |
| A: SMILES notation of 2-Ethoxynaphthalen-1-yl sulfurofluoridate is CCOc1ccc2ccccc2c1OS(=O)(=O)F. |