5-Chloro-3-phenyl-1H-indole-2-carbonitrile
Modify Date: 2025-09-26 17:21:21
5-Chloro-3-phenyl-1H-indole-2-carbonitrile structure
|
Common Name | 5-Chloro-3-phenyl-1H-indole-2-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 24139-17-1 | Molecular Weight | 252.69800 | |
| Density | 1.36g/cm3 | Boiling Point | 507.8ºC at 760mmHg | |
| Molecular Formula | C15H9ClN2 | Melting Point | 213-215ºC | |
| MSDS | N/A | Flash Point | 260.9ºC | |
| Name | 5-Chloro-3-phenyl-1H-indole-2-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 507.8ºC at 760mmHg |
| Melting Point | 213-215ºC |
| Molecular Formula | C15H9ClN2 |
| Molecular Weight | 252.69800 |
| Flash Point | 260.9ºC |
| Exact Mass | 252.04500 |
| PSA | 39.58000 |
| LogP | 4.35998 |
| Vapour Pressure | 1.97E-10mmHg at 25°C |
| Index of Refraction | 1.712 |
| InChIKey | IMUZPCJSWNBMLL-UHFFFAOYSA-N |
| SMILES | N#Cc1[nH]c2ccc(Cl)cc2c1-c1ccccc1 |
| HS Code | 2933990090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
CAS#:719-59-5
CAS#:74868-71-6| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Phenyl-6-chlor-indol-2-carbonitril |
| chlorophenylindolecarbonitrile |
| 5-Chlor-3-phenylindol-2-carbonitril |
| 5-chloro-3-phenyl-indole-2-carbonitrile |
| 5-Chloro-3-phenylindol-2-carbonitril |
| 3-phenyl-5-chloroindole-2-carbonitrile |
| 3-Phenyl-5-chlor-indol-2-carbonitril |