Acetamide,N-[4-[[(dimethylamino)methylene]amino]phenyl]- structure
|
Common Name | Acetamide,N-[4-[[(dimethylamino)methylene]amino]phenyl]- | ||
|---|---|---|---|---|
| CAS Number | 2415-66-9 | Molecular Weight | 205.25600 | |
| Density | 1.04g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H15N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[4-(dimethylaminomethylideneamino)phenyl]acetamide |
|---|
| Density | 1.04g/cm3 |
|---|---|
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.25600 |
| Exact Mass | 205.12200 |
| PSA | 44.70000 |
| LogP | 1.93940 |
| Index of Refraction | 1.535 |
| InChIKey | WRETZXASQHUOEK-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(N=CN(C)C)cc1 |
| HS Code | 2925290090 |
|---|
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |