2-(5-Chloro-3-nitro-2-pyridyl)-N,N-dimethylvinylamine
Modify Date: 2025-09-05 19:16:56
2-(5-Chloro-3-nitro-2-pyridyl)-N,N-dimethylvinylamine structure
|
Common Name | 2-(5-Chloro-3-nitro-2-pyridyl)-N,N-dimethylvinylamine | ||
|---|---|---|---|---|
| CAS Number | 2415768-66-8 | Molecular Weight | 227.65 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H10ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(5-Chloro-3-nitro-2-pyridyl)-N,N-dimethylvinylamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H10ClN3O2 |
|---|---|
| Molecular Weight | 227.65 |
| InChIKey | JPICDSSHFLEZPZ-ONEGZZNKSA-N |
| SMILES | CN(C)C=Cc1ncc(Cl)cc1[N+](=O)[O-] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2-(5-Chloro-3-nitro-2-pyridyl)-N,N-dimethylvinylamine? |
| A: SMILES notation of 2-(5-Chloro-3-nitro-2-pyridyl)-N,N-dimethylvinylamine is CN(C)C=Cc1ncc(Cl)cc1[N+](=O)[O-]. |
| Q: What is the Chinese name of 2415768-66-8? |
| A: Chinese name of 2415768-66-8 is 2415768-66-8. |
| Q: What is the molecular formula of 2-(5-Chloro-3-nitro-2-pyridyl)-N,N-dimethylvinylamine? |
| A: Molecular formula of 2-(5-Chloro-3-nitro-2-pyridyl)-N,N-dimethylvinylamine is C9H10ClN3O2. |
| Q: What is the molecular weight of 2-(5-Chloro-3-nitro-2-pyridyl)-N,N-dimethylvinylamine? |
| A: Molecular weight of 2-(5-Chloro-3-nitro-2-pyridyl)-N,N-dimethylvinylamine is 227.65. |
| Q: What is the InChIKey of 2-(5-Chloro-3-nitro-2-pyridyl)-N,N-dimethylvinylamine? |
| A: InChIKey of 2-(5-Chloro-3-nitro-2-pyridyl)-N,N-dimethylvinylamine is JPICDSSHFLEZPZ-ONEGZZNKSA-N. |
| Q: What is the CAS number of 2-(5-Chloro-3-nitro-2-pyridyl)-N,N-dimethylvinylamine? |
| A: CAS number of 2-(5-Chloro-3-nitro-2-pyridyl)-N,N-dimethylvinylamine is 2415768-66-8. |
| Q: What is the English name of 2-(5-Chloro-3-nitro-2-pyridyl)-N,N-dimethylvinylamine? |
| A: The English name of 2-(5-Chloro-3-nitro-2-pyridyl)-N,N-dimethylvinylamine is 2-(5-Chloro-3-nitro-2-pyridyl)-N,N-dimethylvinylamine. |