2-[(5,5-Dimethoxypentyl)oxy]-4-(4-methyl-1,3-thiazol-5-yl)benzamide
Modify Date: 2025-08-27 15:10:35
![2-[(5,5-Dimethoxypentyl)oxy]-4-(4-methyl-1,3-thiazol-5-yl)benzamide Structure](https://www.chemsrc.com/extcaspic/013/2416231-01-9.png)
2-[(5,5-Dimethoxypentyl)oxy]-4-(4-methyl-1,3-thiazol-5-yl)benzamide structure
|
Common Name | 2-[(5,5-Dimethoxypentyl)oxy]-4-(4-methyl-1,3-thiazol-5-yl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 2416231-01-9 | Molecular Weight | 364.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H24N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[(5,5-Dimethoxypentyl)oxy]-4-(4-methyl-1,3-thiazol-5-yl)benzamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H24N2O4S |
|---|---|
| Molecular Weight | 364.5 |
| InChIKey | WEQNEIINKLIJCK-UHFFFAOYSA-N |
| SMILES | COC(CCCCOc1cc(-c2scnc2C)ccc1C(N)=O)OC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-[(5,5-Dimethoxypentyl)oxy]-4-(4-methyl-1,3-thiazol-5-yl)benzamide? |
| A: Molecular formula of 2-[(5,5-Dimethoxypentyl)oxy]-4-(4-methyl-1,3-thiazol-5-yl)benzamide is C18H24N2O4S. |
| Q: What is the InChIKey of 2-[(5,5-Dimethoxypentyl)oxy]-4-(4-methyl-1,3-thiazol-5-yl)benzamide? |
| A: InChIKey of 2-[(5,5-Dimethoxypentyl)oxy]-4-(4-methyl-1,3-thiazol-5-yl)benzamide is WEQNEIINKLIJCK-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2-[(5,5-Dimethoxypentyl)oxy]-4-(4-methyl-1,3-thiazol-5-yl)benzamide? |
| A: SMILES notation of 2-[(5,5-Dimethoxypentyl)oxy]-4-(4-methyl-1,3-thiazol-5-yl)benzamide is COC(CCCCOc1cc(-c2scnc2C)ccc1C(N)=O)OC. |
| Q: What is the CAS number of 2-[(5,5-Dimethoxypentyl)oxy]-4-(4-methyl-1,3-thiazol-5-yl)benzamide? |
| A: CAS number of 2-[(5,5-Dimethoxypentyl)oxy]-4-(4-methyl-1,3-thiazol-5-yl)benzamide is 2416231-01-9. |
| Q: What is the molecular weight of 2-[(5,5-Dimethoxypentyl)oxy]-4-(4-methyl-1,3-thiazol-5-yl)benzamide? |
| A: Molecular weight of 2-[(5,5-Dimethoxypentyl)oxy]-4-(4-methyl-1,3-thiazol-5-yl)benzamide is 364.5. |
| Q: What is the English name of 2-[(5,5-Dimethoxypentyl)oxy]-4-(4-methyl-1,3-thiazol-5-yl)benzamide? |
| A: The English name of 2-[(5,5-Dimethoxypentyl)oxy]-4-(4-methyl-1,3-thiazol-5-yl)benzamide is 2-[(5,5-Dimethoxypentyl)oxy]-4-(4-methyl-1,3-thiazol-5-yl)benzamide. |
| Q: What is the Chinese name of 2416231-01-9? |
| A: Chinese name of 2416231-01-9 is 2416231-01-9. |