[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl] acetate structure
|
Common Name | [1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl] acetate | ||
|---|---|---|---|---|
| CAS Number | 24165-09-1 | Molecular Weight | 278.07200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H3F9O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl] acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H3F9O2 |
|---|---|
| Molecular Weight | 278.07200 |
| Exact Mass | 277.99900 |
| PSA | 26.30000 |
| LogP | 2.97520 |
| InChIKey | FGXMSHHEWAZQQV-UHFFFAOYSA-N |
| SMILES | CC(=O)OC(C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| HS Code | 2915390090 |
|---|
| HS Code | 2915390090 |
|---|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |
| 1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl acetate |
| Perfluor-tert.-butyl-acetat |
| Nonafluoro-tert-butyl acetate |
| PC2895 |