PROTAC BRD4 degrader for PAC-1 structure
|
Common Name | PROTAC BRD4 degrader for PAC-1 | ||
|---|---|---|---|---|
| CAS Number | 2417370-39-7 | Molecular Weight | 1306.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C62H77F2N9O12S4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | PROTAC BRD4 degrader for PAC-1 |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C62H77F2N9O12S4 |
|---|---|
| Molecular Weight | 1306.6 |
| InChIKey | SCOQCGGMHFUNNF-FDTYQFAOSA-N |
| SMILES | Cc1ncsc1-c1ccc(CNC(=O)C2CC(OC(=O)OCC(C)(C)SS(C)(=O)=O)CN2C(=O)C(NC(=O)CCCCCCCCCCNC(=O)c2cc3c(cc2CS(C)(=O)=O)-c2cn(C)c(=O)c4[nH]cc(c24)CN3c2ncc(F)cc2F)C(C)(C)C)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of PROTAC BRD4 degrader for PAC-1? |
| A: SMILES notation of PROTAC BRD4 degrader for PAC-1 is Cc1ncsc1-c1ccc(CNC(=O)C2CC(OC(=O)OCC(C)(C)SS(C)(=O)=O)CN2C(=O)C(NC(=O)CCCCCCCCCCNC(=O)c2cc3c(cc2CS(C)(=O)=O)-c2cn(C)c(=O)c4[nH]cc(c24)CN3c2ncc(F)cc2F)C(C)(C)C)cc1. |
| Q: What is the molecular weight of PROTAC BRD4 degrader for PAC-1? |
| A: Molecular weight of PROTAC BRD4 degrader for PAC-1 is 1306.6. |
| Q: What is the molecular formula of PROTAC BRD4 degrader for PAC-1? |
| A: Molecular formula of PROTAC BRD4 degrader for PAC-1 is C62H77F2N9O12S4. |
| Q: What is the InChIKey of PROTAC BRD4 degrader for PAC-1? |
| A: InChIKey of PROTAC BRD4 degrader for PAC-1 is SCOQCGGMHFUNNF-FDTYQFAOSA-N. |
| Q: What is the English name of PROTAC BRD4 degrader for PAC-1? |
| A: The English name of PROTAC BRD4 degrader for PAC-1 is PROTAC BRD4 degrader for PAC-1. |
| Q: What is the Chinese name of 2417370-39-7? |
| A: Chinese name of 2417370-39-7 is 2417370-39-7. |
| Q: What is the CAS number of PROTAC BRD4 degrader for PAC-1? |
| A: CAS number of PROTAC BRD4 degrader for PAC-1 is 2417370-39-7. |