3-Iodo-2,4,6-trimethyl-5-[(piperazin-1-yl)methyl]benzene-1-sulfonyl fluoride structure
|
Common Name | 3-Iodo-2,4,6-trimethyl-5-[(piperazin-1-yl)methyl]benzene-1-sulfonyl fluoride | ||
|---|---|---|---|---|
| CAS Number | 2418659-74-0 | Molecular Weight | 426.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H20FIN2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Iodo-2,4,6-trimethyl-5-[(piperazin-1-yl)methyl]benzene-1-sulfonyl fluoride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H20FIN2O2S |
|---|---|
| Molecular Weight | 426.29 |
| InChIKey | DUTJCZXKKGNNAP-UHFFFAOYSA-N |
| SMILES | Cc1c(I)c(C)c(S(=O)(=O)F)c(C)c1CN1CCNCC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 3-Iodo-2,4,6-trimethyl-5-[(piperazin-1-yl)methyl]benzene-1-sulfonyl fluoride? |
| A: CAS number of 3-Iodo-2,4,6-trimethyl-5-[(piperazin-1-yl)methyl]benzene-1-sulfonyl fluoride is 2418659-74-0. |
| Q: What is the InChIKey of 3-Iodo-2,4,6-trimethyl-5-[(piperazin-1-yl)methyl]benzene-1-sulfonyl fluoride? |
| A: InChIKey of 3-Iodo-2,4,6-trimethyl-5-[(piperazin-1-yl)methyl]benzene-1-sulfonyl fluoride is DUTJCZXKKGNNAP-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2418659-74-0? |
| A: Chinese name of 2418659-74-0 is 2418659-74-0. |
| Q: What is the molecular formula of 3-Iodo-2,4,6-trimethyl-5-[(piperazin-1-yl)methyl]benzene-1-sulfonyl fluoride? |
| A: Molecular formula of 3-Iodo-2,4,6-trimethyl-5-[(piperazin-1-yl)methyl]benzene-1-sulfonyl fluoride is C14H20FIN2O2S. |
| Q: What is the molecular weight of 3-Iodo-2,4,6-trimethyl-5-[(piperazin-1-yl)methyl]benzene-1-sulfonyl fluoride? |
| A: Molecular weight of 3-Iodo-2,4,6-trimethyl-5-[(piperazin-1-yl)methyl]benzene-1-sulfonyl fluoride is 426.29. |
| Q: What is the English name of 3-Iodo-2,4,6-trimethyl-5-[(piperazin-1-yl)methyl]benzene-1-sulfonyl fluoride? |
| A: The English name of 3-Iodo-2,4,6-trimethyl-5-[(piperazin-1-yl)methyl]benzene-1-sulfonyl fluoride is 3-Iodo-2,4,6-trimethyl-5-[(piperazin-1-yl)methyl]benzene-1-sulfonyl fluoride. |
| Q: What is the SMILES notation of 3-Iodo-2,4,6-trimethyl-5-[(piperazin-1-yl)methyl]benzene-1-sulfonyl fluoride? |
| A: SMILES notation of 3-Iodo-2,4,6-trimethyl-5-[(piperazin-1-yl)methyl]benzene-1-sulfonyl fluoride is Cc1c(I)c(C)c(S(=O)(=O)F)c(C)c1CN1CCNCC1. |