tert-butyl N-{5-[(fluorosulfonyl)oxy]-2-methyl-3-[(piperazin-1-yl)methyl]phenyl}carbamate structure
|
Common Name | tert-butyl N-{5-[(fluorosulfonyl)oxy]-2-methyl-3-[(piperazin-1-yl)methyl]phenyl}carbamate | ||
|---|---|---|---|---|
| CAS Number | 2418714-03-9 | Molecular Weight | 403.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H26FN3O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-butyl N-{5-[(fluorosulfonyl)oxy]-2-methyl-3-[(piperazin-1-yl)methyl]phenyl}carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H26FN3O5S |
|---|---|
| Molecular Weight | 403.5 |
| InChIKey | FQSBXPGUYXUUHX-UHFFFAOYSA-N |
| SMILES | Cc1c(CN2CCNCC2)cc(OS(=O)(=O)F)cc1NC(=O)OC(C)(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of tert-butyl N-{5-[(fluorosulfonyl)oxy]-2-methyl-3-[(piperazin-1-yl)methyl]phenyl}carbamate? |
| A: SMILES notation of tert-butyl N-{5-[(fluorosulfonyl)oxy]-2-methyl-3-[(piperazin-1-yl)methyl]phenyl}carbamate is Cc1c(CN2CCNCC2)cc(OS(=O)(=O)F)cc1NC(=O)OC(C)(C)C. |
| Q: What is the InChIKey of tert-butyl N-{5-[(fluorosulfonyl)oxy]-2-methyl-3-[(piperazin-1-yl)methyl]phenyl}carbamate? |
| A: InChIKey of tert-butyl N-{5-[(fluorosulfonyl)oxy]-2-methyl-3-[(piperazin-1-yl)methyl]phenyl}carbamate is FQSBXPGUYXUUHX-UHFFFAOYSA-N. |
| Q: What is the English name of tert-butyl N-{5-[(fluorosulfonyl)oxy]-2-methyl-3-[(piperazin-1-yl)methyl]phenyl}carbamate? |
| A: The English name of tert-butyl N-{5-[(fluorosulfonyl)oxy]-2-methyl-3-[(piperazin-1-yl)methyl]phenyl}carbamate is tert-butyl N-{5-[(fluorosulfonyl)oxy]-2-methyl-3-[(piperazin-1-yl)methyl]phenyl}carbamate. |
| Q: What is the CAS number of tert-butyl N-{5-[(fluorosulfonyl)oxy]-2-methyl-3-[(piperazin-1-yl)methyl]phenyl}carbamate? |
| A: CAS number of tert-butyl N-{5-[(fluorosulfonyl)oxy]-2-methyl-3-[(piperazin-1-yl)methyl]phenyl}carbamate is 2418714-03-9. |
| Q: What is the molecular weight of tert-butyl N-{5-[(fluorosulfonyl)oxy]-2-methyl-3-[(piperazin-1-yl)methyl]phenyl}carbamate? |
| A: Molecular weight of tert-butyl N-{5-[(fluorosulfonyl)oxy]-2-methyl-3-[(piperazin-1-yl)methyl]phenyl}carbamate is 403.5. |
| Q: What is the molecular formula of tert-butyl N-{5-[(fluorosulfonyl)oxy]-2-methyl-3-[(piperazin-1-yl)methyl]phenyl}carbamate? |
| A: Molecular formula of tert-butyl N-{5-[(fluorosulfonyl)oxy]-2-methyl-3-[(piperazin-1-yl)methyl]phenyl}carbamate is C17H26FN3O5S. |
| Q: What is the Chinese name of 2418714-03-9? |
| A: Chinese name of 2418714-03-9 is 2418714-03-9. |