(9H-fluoren-9-yl)methyl N-[3-(aminomethyl)-4-methyl-5-sulfanylphenyl]-N-methylcarbamate
Modify Date: 2025-08-28 08:11:31
![(9H-fluoren-9-yl)methyl N-[3-(aminomethyl)-4-methyl-5-sulfanylphenyl]-N-methylcarbamate Structure](https://www.chemsrc.com/extcaspic/010/2418723-47-2.png)
(9H-fluoren-9-yl)methyl N-[3-(aminomethyl)-4-methyl-5-sulfanylphenyl]-N-methylcarbamate structure
|
Common Name | (9H-fluoren-9-yl)methyl N-[3-(aminomethyl)-4-methyl-5-sulfanylphenyl]-N-methylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 2418723-47-2 | Molecular Weight | 404.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H24N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (9H-fluoren-9-yl)methyl N-[3-(aminomethyl)-4-methyl-5-sulfanylphenyl]-N-methylcarbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C24H24N2O2S |
|---|---|
| Molecular Weight | 404.5 |
| InChIKey | XBKWSJPPIRNUHC-UHFFFAOYSA-N |
| SMILES | Cc1c(S)cc(N(C)C(=O)OCC2c3ccccc3-c3ccccc32)cc1CN |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of (9H-fluoren-9-yl)methyl N-[3-(aminomethyl)-4-methyl-5-sulfanylphenyl]-N-methylcarbamate? |
| A: SMILES notation of (9H-fluoren-9-yl)methyl N-[3-(aminomethyl)-4-methyl-5-sulfanylphenyl]-N-methylcarbamate is Cc1c(S)cc(N(C)C(=O)OCC2c3ccccc3-c3ccccc32)cc1CN. |
| Q: What is the English name of (9H-fluoren-9-yl)methyl N-[3-(aminomethyl)-4-methyl-5-sulfanylphenyl]-N-methylcarbamate? |
| A: The English name of (9H-fluoren-9-yl)methyl N-[3-(aminomethyl)-4-methyl-5-sulfanylphenyl]-N-methylcarbamate is (9H-fluoren-9-yl)methyl N-[3-(aminomethyl)-4-methyl-5-sulfanylphenyl]-N-methylcarbamate. |
| Q: What is the CAS number of (9H-fluoren-9-yl)methyl N-[3-(aminomethyl)-4-methyl-5-sulfanylphenyl]-N-methylcarbamate? |
| A: CAS number of (9H-fluoren-9-yl)methyl N-[3-(aminomethyl)-4-methyl-5-sulfanylphenyl]-N-methylcarbamate is 2418723-47-2. |
| Q: What is the Chinese name of 2418723-47-2? |
| A: Chinese name of 2418723-47-2 is 2418723-47-2. |
| Q: What is the InChIKey of (9H-fluoren-9-yl)methyl N-[3-(aminomethyl)-4-methyl-5-sulfanylphenyl]-N-methylcarbamate? |
| A: InChIKey of (9H-fluoren-9-yl)methyl N-[3-(aminomethyl)-4-methyl-5-sulfanylphenyl]-N-methylcarbamate is XBKWSJPPIRNUHC-UHFFFAOYSA-N. |
| Q: What is the molecular weight of (9H-fluoren-9-yl)methyl N-[3-(aminomethyl)-4-methyl-5-sulfanylphenyl]-N-methylcarbamate? |
| A: Molecular weight of (9H-fluoren-9-yl)methyl N-[3-(aminomethyl)-4-methyl-5-sulfanylphenyl]-N-methylcarbamate is 404.5. |
| Q: What is the molecular formula of (9H-fluoren-9-yl)methyl N-[3-(aminomethyl)-4-methyl-5-sulfanylphenyl]-N-methylcarbamate? |
| A: Molecular formula of (9H-fluoren-9-yl)methyl N-[3-(aminomethyl)-4-methyl-5-sulfanylphenyl]-N-methylcarbamate is C24H24N2O2S. |