decahydrotrimethyl-beta-naphthyl acetate structure
|
Common Name | decahydrotrimethyl-beta-naphthyl acetate | ||
|---|---|---|---|---|
| CAS Number | 24238-95-7 | Molecular Weight | 238.36600 | |
| Density | 0.97 g/cm3 | Boiling Point | 278.5ºC at 760 mmHg | |
| Molecular Formula | C15H26O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 126.6ºC | |
| Name | (5,5,8a-trimethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-2-yl) acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.97 g/cm3 |
|---|---|
| Boiling Point | 278.5ºC at 760 mmHg |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.36600 |
| Flash Point | 126.6ºC |
| Exact Mass | 238.19300 |
| PSA | 26.30000 |
| LogP | 3.79050 |
| Vapour Pressure | 0.00649mmHg at 25°C |
| Index of Refraction | 1.479 |
| InChIKey | RFEUMWKMELDWIM-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1CCC2C(C)(C)CCCC2(C)C1 |
| HS Code | 2915390090 |
|---|
| HS Code | 2915390090 |
|---|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |
| EINECS 246-105-7 |
| 2-Naphthalenol,decahydro-5,5,8a-trimethyl-,acetate |
| 5,5,8a-trimethyldecahydronaphthalen-2-yl acetate |
| 1,7,7-Trimethylbicyclo<4.4.0>decanol-(3)-acetat |
| 2-Naphthol,decahydro-5,5,8a-trimethyl-,acetate |
| Decahydro-5,5,8a-trimethyl-2-naphthyl acetate |