Benzyl (S,E)-4-(((tert-butylsulfinyl)imino)methyl)piperidine-1-carboxylate
Modify Date: 2025-09-09 19:47:31
Benzyl (S,E)-4-(((tert-butylsulfinyl)imino)methyl)piperidine-1-carboxylate structure
|
Common Name | Benzyl (S,E)-4-(((tert-butylsulfinyl)imino)methyl)piperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2423977-47-1 | Molecular Weight | 350.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H26N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzyl (S,E)-4-(((tert-butylsulfinyl)imino)methyl)piperidine-1-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H26N2O3S |
|---|---|
| Molecular Weight | 350.5 |
| InChIKey | QNICHEIIQSTGGE-CPNJWEJPSA-N |
| SMILES | CC(C)(C)S(=O)N=CC1CCN(C(=O)OCc2ccccc2)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Benzyl (S,E)-4-(((tert-butylsulfinyl)imino)methyl)piperidine-1-carboxylate? |
| A: SMILES notation of Benzyl (S,E)-4-(((tert-butylsulfinyl)imino)methyl)piperidine-1-carboxylate is CC(C)(C)S(=O)N=CC1CCN(C(=O)OCc2ccccc2)CC1. |
| Q: What is the English name of Benzyl (S,E)-4-(((tert-butylsulfinyl)imino)methyl)piperidine-1-carboxylate? |
| A: The English name of Benzyl (S,E)-4-(((tert-butylsulfinyl)imino)methyl)piperidine-1-carboxylate is Benzyl (S,E)-4-(((tert-butylsulfinyl)imino)methyl)piperidine-1-carboxylate. |
| Q: What is the molecular weight of Benzyl (S,E)-4-(((tert-butylsulfinyl)imino)methyl)piperidine-1-carboxylate? |
| A: Molecular weight of Benzyl (S,E)-4-(((tert-butylsulfinyl)imino)methyl)piperidine-1-carboxylate is 350.5. |
| Q: What is the molecular formula of Benzyl (S,E)-4-(((tert-butylsulfinyl)imino)methyl)piperidine-1-carboxylate? |
| A: Molecular formula of Benzyl (S,E)-4-(((tert-butylsulfinyl)imino)methyl)piperidine-1-carboxylate is C18H26N2O3S. |
| Q: What is the CAS number of Benzyl (S,E)-4-(((tert-butylsulfinyl)imino)methyl)piperidine-1-carboxylate? |
| A: CAS number of Benzyl (S,E)-4-(((tert-butylsulfinyl)imino)methyl)piperidine-1-carboxylate is 2423977-47-1. |
| Q: What is the InChIKey of Benzyl (S,E)-4-(((tert-butylsulfinyl)imino)methyl)piperidine-1-carboxylate? |
| A: InChIKey of Benzyl (S,E)-4-(((tert-butylsulfinyl)imino)methyl)piperidine-1-carboxylate is QNICHEIIQSTGGE-CPNJWEJPSA-N. |
| Q: What is the Chinese name of 2423977-47-1? |
| A: Chinese name of 2423977-47-1 is 2423977-47-1. |