6-Ketotetradecanoic acid methyl ester
6-Ketotetradecanoic acid methyl ester structure
|
Common Name | 6-Ketotetradecanoic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 24243-17-2 | Molecular Weight | 256.38100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H28O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 6-oxotetradecanoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H28O3 |
|---|---|
| Molecular Weight | 256.38100 |
| Exact Mass | 256.20400 |
| PSA | 43.37000 |
| LogP | 4.03950 |
| InChIKey | MXVYJCWSFMYOMX-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC(=O)CCCCC(=O)OC |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2918300090 |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:1747-18-8This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 6-Ketotetradecanoic acid methyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of methyl 6-oxotetradecanoate? |
| A: CAS number of methyl 6-oxotetradecanoate is 24243-17-2. |
| Q: What is the polar surface area (PSA) of methyl 6-oxotetradecanoate? |
| A: Polar surface area (PSA) of methyl 6-oxotetradecanoate is 43.37000. |
| Q: What is the molecular formula of methyl 6-oxotetradecanoate? |
| A: Molecular formula of methyl 6-oxotetradecanoate is C15H28O3. |
| Q: What is the LogP of methyl 6-oxotetradecanoate? |
| A: LogP of methyl 6-oxotetradecanoate is 4.03950. |
| Q: What is the English name of methyl 6-oxotetradecanoate? |
| A: The English name of methyl 6-oxotetradecanoate is methyl 6-oxotetradecanoate. |
| Q: What are the downstream products of methyl 6-oxotetradecanoate? |
| A: Related downstream products(CAS) of methyl 6-oxotetradecanoate: 1747-18-8. |
| Q: What is the InChIKey of methyl 6-oxotetradecanoate? |
| A: InChIKey of methyl 6-oxotetradecanoate is MXVYJCWSFMYOMX-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 24243-17-2? |
| A: Chinese name of 24243-17-2 is 24243-17-2. |
| Q: What is the molecular weight of methyl 6-oxotetradecanoate? |
| A: Molecular weight of methyl 6-oxotetradecanoate is 256.38100. |
| Q: What is the SMILES notation of methyl 6-oxotetradecanoate? |
| A: SMILES notation of methyl 6-oxotetradecanoate is CCCCCCCCC(=O)CCCCC(=O)OC. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |