4-Oxo-4-[(2-oxo-2-phenylethyl)amino]butanoic acid structure
|
Common Name | 4-Oxo-4-[(2-oxo-2-phenylethyl)amino]butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 24246-92-2 | Molecular Weight | 235.23600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-Oxo-4-[(2-oxo-2-phenylethyl)amino]butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H13NO4 |
|---|---|
| Molecular Weight | 235.23600 |
| Exact Mass | 235.08400 |
| PSA | 86.96000 |
| LogP | 1.69060 |
| InChIKey | DCAKUOVISGPERC-UHFFFAOYSA-N |
| SMILES | O=C(O)CCC(=O)NCC(=O)c1ccccc1 |
| HS Code | 2924299090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: Dicer-mediated maturation of pre-microRNA
Source: Center for Chemical Genomics, University of Michigan
Target: N/A
External Id: TargetID_659_CEMA
|
| N-(2-o-Methoxyphenoxyethyl)-6,7-dimethoxy-1,2,3,4-tetrahydro-2-isochinolincarboxamidin |
| N-(2-oxo-2-phenyl-ethyl)-succinamic acid |
| 6,7-dimethoxy-N'-[2-(2-methoxyphenoxy)ethyl]-3,4-dihydroisoquinoline-2(1H)-carboximidamide |
| N-(2-o-Methoxyphenoxyethyl)-6,7-dimethoxy-3,4-dihydro-2-(1H)-isoquinoline carboxamidine |