5-Chloro-3-[3-chlorophenyl-1-(tetra-hydropyran-2-yloxy) methyl]-[1,2,4]thiadiazole
Modify Date: 2026-09-27 18:40:20
![5-Chloro-3-[3-chlorophenyl-1-(tetra-hydropyran-2-yloxy) methyl]-[1,2,4]thiadiazole Structure](https://www.chemsrc.com/extcaspic/399/242486-98-2.png)
5-Chloro-3-[3-chlorophenyl-1-(tetra-hydropyran-2-yloxy) methyl]-[1,2,4]thiadiazole structure
|
Common Name | 5-Chloro-3-[3-chlorophenyl-1-(tetra-hydropyran-2-yloxy) methyl]-[1,2,4]thiadiazole | ||
|---|---|---|---|---|
| CAS Number | 242486-98-2 | Molecular Weight | 345.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14Cl2N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-Chloro-3-[3-chlorophenyl-1-(tetra-hydropyran-2-yloxy) methyl]-[1,2,4]thiadiazole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H14Cl2N2O2S |
|---|---|
| Molecular Weight | 345.2 |
| InChIKey | ZSMFSWAKIQQKDP-UHFFFAOYSA-N |
| SMILES | Clc1cccc(C(OC2CCCCO2)c2nsc(Cl)n2)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 242486-98-2? |
| A: Chinese name of 242486-98-2 is 242486-98-2. |
| Q: What is the CAS number of 5-Chloro-3-[3-chlorophenyl-1-(tetra-hydropyran-2-yloxy) methyl]-[1,2,4]thiadiazole? |
| A: CAS number of 5-Chloro-3-[3-chlorophenyl-1-(tetra-hydropyran-2-yloxy) methyl]-[1,2,4]thiadiazole is 242486-98-2. |
| Q: What is the molecular formula of 5-Chloro-3-[3-chlorophenyl-1-(tetra-hydropyran-2-yloxy) methyl]-[1,2,4]thiadiazole? |
| A: Molecular formula of 5-Chloro-3-[3-chlorophenyl-1-(tetra-hydropyran-2-yloxy) methyl]-[1,2,4]thiadiazole is C14H14Cl2N2O2S. |
| Q: What is the molecular weight of 5-Chloro-3-[3-chlorophenyl-1-(tetra-hydropyran-2-yloxy) methyl]-[1,2,4]thiadiazole? |
| A: Molecular weight of 5-Chloro-3-[3-chlorophenyl-1-(tetra-hydropyran-2-yloxy) methyl]-[1,2,4]thiadiazole is 345.2. |
| Q: What is the SMILES notation of 5-Chloro-3-[3-chlorophenyl-1-(tetra-hydropyran-2-yloxy) methyl]-[1,2,4]thiadiazole? |
| A: SMILES notation of 5-Chloro-3-[3-chlorophenyl-1-(tetra-hydropyran-2-yloxy) methyl]-[1,2,4]thiadiazole is Clc1cccc(C(OC2CCCCO2)c2nsc(Cl)n2)c1. |
| Q: What is the English name of 5-Chloro-3-[3-chlorophenyl-1-(tetra-hydropyran-2-yloxy) methyl]-[1,2,4]thiadiazole? |
| A: The English name of 5-Chloro-3-[3-chlorophenyl-1-(tetra-hydropyran-2-yloxy) methyl]-[1,2,4]thiadiazole is 5-Chloro-3-[3-chlorophenyl-1-(tetra-hydropyran-2-yloxy) methyl]-[1,2,4]thiadiazole. |
| Q: What is the InChIKey of 5-Chloro-3-[3-chlorophenyl-1-(tetra-hydropyran-2-yloxy) methyl]-[1,2,4]thiadiazole? |
| A: InChIKey of 5-Chloro-3-[3-chlorophenyl-1-(tetra-hydropyran-2-yloxy) methyl]-[1,2,4]thiadiazole is ZSMFSWAKIQQKDP-UHFFFAOYSA-N. |