N-carbamoyl-2-diethoxyphosphinothioylsulfanylacetamide
N-carbamoyl-2-diethoxyphosphinothioylsulfanylacetamide structure
|
Common Name | N-carbamoyl-2-diethoxyphosphinothioylsulfanylacetamide | ||
|---|---|---|---|---|
| CAS Number | 2425-16-3 | Molecular Weight | 286.30900 | |
| Density | 1.366g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H15N2O4PS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-carbamoyl-2-diethoxyphosphinothioylsulfanylacetamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.366g/cm3 |
|---|---|
| Molecular Formula | C7H15N2O4PS2 |
| Molecular Weight | 286.30900 |
| Exact Mass | 286.02100 |
| PSA | 162.33000 |
| LogP | 3.21670 |
| Index of Refraction | 1.555 |
| InChIKey | XYKRSZGFPADKEN-UHFFFAOYSA-N |
| SMILES | CCOP(=S)(OCC)SCC(=O)NC(N)=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
N-carbamoyl-2-d... CAS#:2425-16-3 |
| Literature: Am.Cyanamid Co. Patent: DE807687 , 1949 ; Full Text Show Details Am.Cyanamid Co. Patent: US2494126 , 1948 ; DRP/DRBP Org.Chem. Full Text Show Details Hoegberg; Cassaday Journal of the American Chemical Society, 1951 , vol. 73, p. 557 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (diethoxythiophosphorylsulfanyl-acetyl)-urea |
| Phosphorodithioic acid,O,O-diethyl ester,S-ester with (mercaptoacetyl)urea |
| S-[2-(carbamoylamino)-2-oxoethyl] O,O-diethyl phosphorodithioate |
| Urea,mercaptoacetyl-,S-ester with O,O-diethyl phosphorodithioate |
| Phosphorodithioic acid,S-(2-((aminocarbonyl)amino)-2-oxoethyl) O,O-diethyl ester |
| Diaethoxythiophosphorylmercapto-essigsaeure-ureid |
| (Diaethoxythiophosphorylmercapto-acetyl)-harnstoff |
| Dithiophosphorsaeure-O,O'-diaethylester-S-allophanoylmethylester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of N-carbamoyl-2-diethoxyphosphinothioylsulfanylacetamide? |
| A: Molecular weight of N-carbamoyl-2-diethoxyphosphinothioylsulfanylacetamide is 286.30900. |
| Q: What is the molecular formula of N-carbamoyl-2-diethoxyphosphinothioylsulfanylacetamide? |
| A: Molecular formula of N-carbamoyl-2-diethoxyphosphinothioylsulfanylacetamide is C7H15N2O4PS2. |
| Q: What is the English name of N-carbamoyl-2-diethoxyphosphinothioylsulfanylacetamide? |
| A: The English name of N-carbamoyl-2-diethoxyphosphinothioylsulfanylacetamide is N-carbamoyl-2-diethoxyphosphinothioylsulfanylacetamide. |
| Q: What is the Chinese name of 2425-16-3? |
| A: Chinese name of 2425-16-3 is 2425-16-3. |
| Q: What are the upstream materials of N-carbamoyl-2-diethoxyphosphinothioylsulfanylacetamide? |
| A: Related upstream materials(CAS) of N-carbamoyl-2-diethoxyphosphinothioylsulfanylacetamide: 4791-21-3;3338-24-7. |
| Q: What is the InChIKey of N-carbamoyl-2-diethoxyphosphinothioylsulfanylacetamide? |
| A: InChIKey of N-carbamoyl-2-diethoxyphosphinothioylsulfanylacetamide is XYKRSZGFPADKEN-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of N-carbamoyl-2-diethoxyphosphinothioylsulfanylacetamide? |
| A: SMILES notation of N-carbamoyl-2-diethoxyphosphinothioylsulfanylacetamide is CCOP(=S)(OCC)SCC(=O)NC(N)=O. |
| Q: What is the LogP of N-carbamoyl-2-diethoxyphosphinothioylsulfanylacetamide? |
| A: LogP of N-carbamoyl-2-diethoxyphosphinothioylsulfanylacetamide is 3.21670. |
| Q: What is the polar surface area (PSA) of N-carbamoyl-2-diethoxyphosphinothioylsulfanylacetamide? |
| A: Polar surface area (PSA) of N-carbamoyl-2-diethoxyphosphinothioylsulfanylacetamide is 162.33000. |
| Q: What is the CAS number of N-carbamoyl-2-diethoxyphosphinothioylsulfanylacetamide? |
| A: CAS number of N-carbamoyl-2-diethoxyphosphinothioylsulfanylacetamide is 2425-16-3. |