β-Methyl-4-nitrohydrocinnamic acid methyl ester structure
|
Common Name | β-Methyl-4-nitrohydrocinnamic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 24254-61-3 | Molecular Weight | 223.22500 | |
| Density | 1.188g/cm3 | Boiling Point | 322.7ºC at 760 mmHg | |
| Molecular Formula | C11H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 135.9ºC | |
| Name | methyl 3-(4-nitrophenyl)butanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.188g/cm3 |
|---|---|
| Boiling Point | 322.7ºC at 760 mmHg |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.22500 |
| Flash Point | 135.9ºC |
| Exact Mass | 223.08400 |
| PSA | 72.12000 |
| LogP | 2.78460 |
| Vapour Pressure | 0.000274mmHg at 25°C |
| Index of Refraction | 1.529 |
| InChIKey | LGXBWSXGLXOQDJ-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(C)c1ccc([N+](=O)[O-])cc1 |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 3-(4-Nitrophenyl)butanoic acid methyl ester |
| 3-p-Nitrophenylmethylbutyrat |
| methyl 3-(4-nitrophenyl)butyrate |