[2-(dimethylamino)phenyl]-trimethylazanium,iodide structure
|
Common Name | [2-(dimethylamino)phenyl]-trimethylazanium,iodide | ||
|---|---|---|---|---|
| CAS Number | 2427-09-0 | Molecular Weight | 306.18600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H19IN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [2-(dimethylamino)phenyl]-trimethylazanium,iodide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H19IN2 |
|---|---|
| Molecular Weight | 306.18600 |
| Exact Mass | 306.05900 |
| PSA | 3.24000 |
| InChIKey | PGLJQIGWMGBYRA-UHFFFAOYSA-M |
| SMILES | CN(C)c1ccccc1[N+](C)(C)C.[I-] |
|
~84%
[2-(dimethylami... CAS#:2427-09-0 |
| Literature: Bock, Hans; Nagel, Norbert Zeitschrift fur Naturforschung - Section B Journal of Chemical Sciences, 1998 , vol. 53, # 8 p. 792 - 804 |
|
~%
[2-(dimethylami... CAS#:2427-09-0 |
| Literature: Brown; Nelson Journal of the American Chemical Society, 1953 , vol. 75, p. 24,27 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-Dimethylamino-tri-N-methyl-anilinium,Jodid |
| 2-dimethylamino-tri-N-methyl-anilinium,iodide |
| Benzenaminium,2-(dimethylamino)-N,N,N-trimethyl-,iodide |