Pentafluoropropionic acid p-tolyl ester structure
|
Common Name | Pentafluoropropionic acid p-tolyl ester | ||
|---|---|---|---|---|
| CAS Number | 24271-52-1 | Molecular Weight | 254.15300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H7F5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-methylphenyl) 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H7F5O2 |
|---|---|
| Molecular Weight | 254.15300 |
| Exact Mass | 254.03700 |
| PSA | 26.30000 |
| LogP | 3.09800 |
| Vapour Pressure | 0.665mmHg at 25°C |
| InChIKey | IJLZCCFDKNCXTR-UHFFFAOYSA-N |
| SMILES | Cc1ccc(OC(=O)C(F)(F)C(F)(F)F)cc1 |
| HS Code | 2915900090 |
|---|
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| Pentafluoropropionic acid p-tolyl ester |