1H-Indene,1-[(2,5-dimethoxyphenyl)methylene]- structure
|
Common Name | 1H-Indene,1-[(2,5-dimethoxyphenyl)methylene]- | ||
|---|---|---|---|---|
| CAS Number | 2428-42-4 | Molecular Weight | 264.31800 | |
| Density | 1.161g/cm3 | Boiling Point | 421.5ºC at 760 mmHg | |
| Molecular Formula | C18H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.5ºC | |
| Name | 1-[(2,5-dimethoxyphenyl)methylidene]indene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.161g/cm3 |
|---|---|
| Boiling Point | 421.5ºC at 760 mmHg |
| Molecular Formula | C18H16O2 |
| Molecular Weight | 264.31800 |
| Flash Point | 171.5ºC |
| Exact Mass | 264.11500 |
| PSA | 18.46000 |
| LogP | 4.27120 |
| Vapour Pressure | 6.36E-07mmHg at 25°C |
| Index of Refraction | 1.64 |
| InChIKey | TVJZQTJEZNQALZ-SDNWHVSQSA-N |
| SMILES | COc1ccc(OC)c(C=C2C=Cc3ccccc32)c1 |
|
~%
1H-Indene,1-[(2... CAS#:2428-42-4 |
| Literature: Bahner,C.T. et al. Journal of Medicinal Chemistry, 1965 , vol. 8, p. 390 - 392 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,5-Dimethoxy-4-nitro-acetophenon |