Bicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylic acid, 2,3-diethyl ester
Modify Date: 2025-09-21 21:08:00
![Bicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylic acid, 2,3-diethyl ester Structure](https://www.chemsrc.com/extcaspic/204/24282-45-9.png)
Bicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylic acid, 2,3-diethyl ester structure
|
Common Name | Bicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylic acid, 2,3-diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 24282-45-9 | Molecular Weight | 236.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Bicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylic acid, 2,3-diethyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H16O4 |
|---|---|
| Molecular Weight | 236.26 |
| InChIKey | VDGBMYHTHINHBJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)C2C=CC1C2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Bicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylic acid, 2,3-diethyl ester? |
| A: InChIKey of Bicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylic acid, 2,3-diethyl ester is VDGBMYHTHINHBJ-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 24282-45-9? |
| A: Chinese name of 24282-45-9 is 24282-45-9. |
| Q: What is the SMILES notation of Bicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylic acid, 2,3-diethyl ester? |
| A: SMILES notation of Bicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylic acid, 2,3-diethyl ester is CCOC(=O)C1=C(C(=O)OCC)C2C=CC1C2. |
| Q: What is the molecular formula of Bicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylic acid, 2,3-diethyl ester? |
| A: Molecular formula of Bicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylic acid, 2,3-diethyl ester is C13H16O4. |
| Q: What is the molecular weight of Bicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylic acid, 2,3-diethyl ester? |
| A: Molecular weight of Bicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylic acid, 2,3-diethyl ester is 236.26. |
| Q: What is the English name of Bicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylic acid, 2,3-diethyl ester? |
| A: The English name of Bicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylic acid, 2,3-diethyl ester is Bicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylic acid, 2,3-diethyl ester. |
| Q: What is the CAS number of Bicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylic acid, 2,3-diethyl ester? |
| A: CAS number of Bicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylic acid, 2,3-diethyl ester is 24282-45-9. |