Crotonic acid, 3,6-dichloro-2,4-dinitrophenyl ester structure
|
Common Name | Crotonic acid, 3,6-dichloro-2,4-dinitrophenyl ester | ||
|---|---|---|---|---|
| CAS Number | 24291-70-1 | Molecular Weight | 321.07000 | |
| Density | 1.595g/cm3 | Boiling Point | 445.3ºC at 760mmHg | |
| Molecular Formula | C10H6Cl2N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.1ºC | |
| Name | (3,6-dichloro-2,4-dinitrophenyl) (E)-but-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.595g/cm3 |
|---|---|
| Boiling Point | 445.3ºC at 760mmHg |
| Molecular Formula | C10H6Cl2N2O6 |
| Molecular Weight | 321.07000 |
| Flash Point | 223.1ºC |
| Exact Mass | 319.96000 |
| PSA | 117.94000 |
| LogP | 4.33770 |
| Vapour Pressure | 3.98E-08mmHg at 25°C |
| Index of Refraction | 1.61 |
| InChIKey | IKGIEJXDCGZBBZ-NSCUHMNNSA-N |
| SMILES | CC=CC(=O)Oc1c(Cl)cc([N+](=O)[O-])c(Cl)c1[N+](=O)[O-] |
| HS Code | 2916190090 |
|---|
| HS Code | 2916190090 |
|---|---|
| Summary | 2916190090 unsaturated acyclic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| Phenol,3,6-dichloro-2,4-dinitro-,crotonate (ester) |
| Crotonate de 2,5-dichloro-4,6-dinitrophenyle [French] |
| 3,6-Dichloro-2,4-dinitrophenyl crotonate |
| Crotonate de 2,5-dichloro-4,6-dinitrophenyle |
| Crotonic acid,3,6-dichloro-2,4-dinitrophenyl ester |
| 2-Butenoic acid,3,6-dichloro-2,4-dinitrophenyl ester |
| 2,5-Dichloro-4,6-dinitrophenyl crotonate |