Dioctyl sebacate structure
|
Common Name | Dioctyl sebacate | ||
|---|---|---|---|---|
| CAS Number | 2432-87-3 | Molecular Weight | 426.673 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 442.0±13.0 °C at 760 mmHg | |
| Molecular Formula | C26H50O4 | Melting Point | -55ºC | |
| MSDS | USA | Flash Point | 198.4±18.2 °C | |
| Name | dioctyl decanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 442.0±13.0 °C at 760 mmHg |
| Melting Point | -55ºC |
| Molecular Formula | C26H50O4 |
| Molecular Weight | 426.673 |
| Flash Point | 198.4±18.2 °C |
| Exact Mass | 426.370911 |
| PSA | 52.60000 |
| LogP | 10.23 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.455 |
| InChIKey | MIMDHDXOBDPUQW-UHFFFAOYSA-N |
| SMILES | CCCCCCCCOC(=O)CCCCCCCCC(=O)OCCCCCCCC |
| Freezing Point | -48℃ |
| HS Code | 2917131000 |
|---|
|
~%
Dioctyl sebacate CAS#:2432-87-3 |
| Literature: Journal of the American Chemical Society, , vol. 74, p. 5487,5488 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917131000 |
|---|---|
| Summary | 2917131000 esters of adipic acid。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| di-octyl sebacate |
| Decanedioic acid, dioctyl ester |
| EINECS 219-411-3 |
| Dioctyl sebacate |
| Decandisaeure-dioctylester |
| Decanedioic acid dioctyl ester |
| dioctyl decanedioate |
| Succinic acid, dioctyl ester |
| Dioctyl succinate |
| Sebacic acid,dioctyl ester |
| Dioctyl butanedioate |
| Sebacic Acid Di-n-octyl Ester |
| Di-n-octyl Sebacate |
| MFCD00059269 |
| Octyl sebacate |
| Sebacinsaeure-di-n-octylester |
| Sebacic acid, dioctyl ester |
| Butanedioic acid, dioctyl ester |
| Witamol 500 |
| Decanedioic acid,dioctyl ester |