2-[3-(N-Ethylacetylamino)-2,4,6-triiodophenoxy]butyric acid structure
|
Common Name | 2-[3-(N-Ethylacetylamino)-2,4,6-triiodophenoxy]butyric acid | ||
|---|---|---|---|---|
| CAS Number | 24340-16-7 | Molecular Weight | 642.99500 | |
| Density | 2.199g/cm3 | Boiling Point | 628.7ºC at 760 mmHg | |
| Molecular Formula | C14H16I3NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 334ºC | |
| Name | 2-[3-[acetyl(ethyl)amino]-2,4,6-triiodophenoxy]butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 2.199g/cm3 |
|---|---|
| Boiling Point | 628.7ºC at 760 mmHg |
| Molecular Formula | C14H16I3NO4 |
| Molecular Weight | 642.99500 |
| Flash Point | 334ºC |
| Exact Mass | 642.82100 |
| PSA | 66.84000 |
| LogP | 4.11520 |
| Vapour Pressure | 1.13E-16mmHg at 25°C |
| Index of Refraction | 1.681 |
| InChIKey | DNUASVBVGIYWCJ-UHFFFAOYSA-N |
| SMILES | CCC(Oc1c(I)cc(I)c(N(CC)C(C)=O)c1I)C(=O)O |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| BUTYRIC ACID,2-(3-(N-ETHYLACETAMIDO)-2,4,6-TRIIODOPHENOXY) |
| 2-[3-(Acetyl-ethyl-amino)-2,4,6-triiod-phenoxy]-buttersaeure |
| 2-(3-(N-Ethylacetamido)-2,4,6-triiodophenoxy)butyric acid |