naphthalen-1-ylsulfamic acid
naphthalen-1-ylsulfamic acid structure
|
Common Name | naphthalen-1-ylsulfamic acid | ||
|---|---|---|---|---|
| CAS Number | 24344-19-2 | Molecular Weight | 223.24800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | naphthalen-1-ylsulfamic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H9NO3S |
|---|---|
| Molecular Weight | 223.24800 |
| Exact Mass | 223.03000 |
| PSA | 74.78000 |
| LogP | 3.20830 |
| InChIKey | XFSXWFOXECTCPD-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)Nc1cccc2ccccc12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 2 | |
CAS#:86-57-7
CAS#:134-32-7
CAS#:21711-65-9
CAS#:607-30-7
CAS#:81-06-1
CAS#:5329-14-6
CAS#:56-23-5
CAS#:7790-94-5
CAS#:67-66-3
CAS#:7732-18-5
CAS#:7664-93-9This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Sulfamic acid,1-naphthalenyl |
| 1-naphthylsulfamic acid |
| Naphthyl-(1)-sulfamidsaeure |
| naphthylaminesulphonic acid |
| [1]Naphthyl-amidoschwefelsaeure |
| [1]naphthyl-amidosulfuric acid |
| naphthylamino-sulfonic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of naphthalen-1-ylsulfamic acid? |
| A: The English name of naphthalen-1-ylsulfamic acid is naphthalen-1-ylsulfamic acid. |
| Q: What is the LogP of naphthalen-1-ylsulfamic acid? |
| A: LogP of naphthalen-1-ylsulfamic acid is 3.20830. |
| Q: What are the downstream products of naphthalen-1-ylsulfamic acid? |
| A: Related downstream products(CAS) of naphthalen-1-ylsulfamic acid: 7664-93-9;134-32-7. |
| Q: What is the InChIKey of naphthalen-1-ylsulfamic acid? |
| A: InChIKey of naphthalen-1-ylsulfamic acid is XFSXWFOXECTCPD-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 24344-19-2? |
| A: Chinese name of 24344-19-2 is 24344-19-2. |
| Q: What are the upstream materials of naphthalen-1-ylsulfamic acid? |
| A: Related upstream materials(CAS) of naphthalen-1-ylsulfamic acid: 86-57-7;134-32-7;21711-65-9;607-30-7;81-06-1;5329-14-6;56-23-5;7790-94-5;67-66-3;7732-18-5. |
| Q: What is the SMILES notation of naphthalen-1-ylsulfamic acid? |
| A: SMILES notation of naphthalen-1-ylsulfamic acid is O=S(=O)(O)Nc1cccc2ccccc12. |
| Q: What is the molecular formula of naphthalen-1-ylsulfamic acid? |
| A: Molecular formula of naphthalen-1-ylsulfamic acid is C10H9NO3S. |
| Q: What English synonyms does naphthalen-1-ylsulfamic acid have? |
| A: English synonyms of naphthalen-1-ylsulfamic acid: Sulfamic acid,1-naphthalenyl, 1-naphthylsulfamic acid, Naphthyl-(1)-sulfamidsaeure, naphthylaminesulphonic acid, [1]Naphthyl-amidoschwefelsaeure, [1]naphthyl-amidosulfuric acid, naphthylamino-sulfonic acid. |
| Q: What is the CAS number of naphthalen-1-ylsulfamic acid? |
| A: CAS number of naphthalen-1-ylsulfamic acid is 24344-19-2. |