α-(Dimethylhydrazono)-4'-phenoxyacetophenone structure
|
Common Name | α-(Dimethylhydrazono)-4'-phenoxyacetophenone | ||
|---|---|---|---|---|
| CAS Number | 24346-20-1 | Molecular Weight | 268.31000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2E)-2-(dimethylhydrazinylidene)-1-(4-phenoxyphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H16N2O2 |
|---|---|
| Molecular Weight | 268.31000 |
| Exact Mass | 268.12100 |
| PSA | 41.90000 |
| LogP | 3.20900 |
| Vapour Pressure | 0mmHg at 25°C |
| InChIKey | AHGTVVKFAJFTJE-SFQUDFHCSA-N |
| SMILES | CN(C)N=CC(=O)c1ccc(Oc2ccccc2)cc1 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| p-Phenoxyphenylglyoxal N,N-dimethylhydrazone |
| GLYOXAL,p-PHENOXYPHENYL-,DIMETHYL HYDRAZONE |