Cholesterol, hydrogenphosphate (8CI) structure
|
Common Name | Cholesterol, hydrogenphosphate (8CI) | ||
|---|---|---|---|---|
| CAS Number | 24352-58-7 | Molecular Weight | 835.27200 | |
| Density | 1.06g/cm3 | Boiling Point | 800.1ºC at 760mmHg | |
| Molecular Formula | C54H91O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 437.7ºC | |
| Name | dicholesteryl hydrogenphosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.06g/cm3 |
|---|---|
| Boiling Point | 800.1ºC at 760mmHg |
| Molecular Formula | C54H91O4P |
| Molecular Weight | 835.27200 |
| Flash Point | 437.7ºC |
| Exact Mass | 834.66500 |
| PSA | 65.57000 |
| LogP | 15.94000 |
| Vapour Pressure | 4.16E-28mmHg at 25°C |
| Index of Refraction | 1.541 |
| InChIKey | ZGBCOZWHGXAJNA-UHFFFAOYSA-N |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC=C4CC(OP(=O)(O)OC5CCC6(C)C(=CCC7C6CCC6(C)C(C(C)CCCC(C)C)CCC76)C5)CCC4(C)C3CCC12C |
|
~%
Cholesterol, hy... CAS#:24352-58-7 |
| Literature: Cremlyn,R.J.W.; Olsson,N.A. Journal of the Chemical Society [Section] C: Organic, 1969 , p. 2305 - 2310 |
|
~%
Cholesterol, hy... CAS#:24352-58-7 |
| Literature: Cremlyn,R.J.W.; Olsson,N.A. Journal of the Chemical Society [Section] C: Organic, 1969 , p. 2305 - 2310 |
|
~%
Cholesterol, hy... CAS#:24352-58-7 |
| Literature: Zeile; Kruckenberg Chemische Berichte, 1942 , vol. 75, p. 1127,1134 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Dicholesterylphosphat |
| N-(2-chloroethyl)phosphoroamidodichloridate |
| Phosphorsaeure-dicholesterylester |
| Phosphoramidic dichloride,(2-chloroethyl) |
| Dicholesteryl-hydrogenphosphat |
| Phosphorsaeure-dichlorid-<2-chlor-ethylamid> |