2-Butenedioic acid,2-(4-chlorophenoxy)-, (Z)- (9CI) structure
|
Common Name | 2-Butenedioic acid,2-(4-chlorophenoxy)-, (Z)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 24355-83-7 | Molecular Weight | 242.61300 | |
| Density | 1.539g/cm3 | Boiling Point | 431.6ºC at 760mmHg | |
| Molecular Formula | C10H7ClO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.8ºC | |
| Name | (Z)-2-(4-chlorophenoxy)but-2-enedioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.539g/cm3 |
|---|---|
| Boiling Point | 431.6ºC at 760mmHg |
| Molecular Formula | C10H7ClO5 |
| Molecular Weight | 242.61300 |
| Flash Point | 214.8ºC |
| Exact Mass | 241.99800 |
| PSA | 83.83000 |
| LogP | 1.77190 |
| Vapour Pressure | 3.24E-08mmHg at 25°C |
| Index of Refraction | 1.611 |
| InChIKey | PVBMXCCBTZBDPB-YVMONPNESA-N |
| SMILES | O=C(O)C=C(Oc1ccc(Cl)cc1)C(=O)O |
|
~%
2-Butenedioic a... CAS#:24355-83-7 |
| Literature: Protiva, Miroslav; Valenta, Vladimir; Kopicova, Zdenka; Lukac, Juraj; Holubek, Jiri; Krejci, Ivan Collection of Czechoslovak Chemical Communications, 1990 , vol. 55, # 5 p. 1278 - 1289 |
|
~%
2-Butenedioic a... CAS#:24355-83-7 |
| Literature: Protiva, Miroslav; Valenta, Vladimir; Kopicova, Zdenka; Lukac, Juraj; Holubek, Jiri; Krejci, Ivan Collection of Czechoslovak Chemical Communications, 1990 , vol. 55, # 5 p. 1278 - 1289 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 2-(4-chlorophenoxy)fumaric acid |
| (4-chloro-phenoxy)-fumaric acid |
| (4-Chlor-phenoxy)-fumarsaeure |