(Rac)-NMDAR antagonist 1 structure
|
Common Name | (Rac)-NMDAR antagonist 1 | ||
|---|---|---|---|---|
| CAS Number | 2435557-99-4 | Molecular Weight | 414.3 | |
| Density | 1.54±0.1 g/cm3(Predicted) | Boiling Point | N/A | |
| Molecular Formula | C20H20BrN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of (Rac)-NMDAR antagonist 1(Rac)-NMDAR antagonist 1 is a potent and orally bioavailable NR2B-selective NMDAR antagonist. |
| Name | (Rac)-NMDAR antagonist 1 |
|---|
| Density | 1.54±0.1 g/cm3(Predicted) |
|---|---|
| Molecular Formula | C20H20BrN3O2 |
| Molecular Weight | 414.3 |
| InChIKey | NCHFPVRYYJGAJY-UHFFFAOYSA-N |
| SMILES | O=C(NCCc1ccc(O)cc1)C1CCC2=Nc3ccc(Br)cc3CN21 |