Phenol,2,4,6-tribromo-, 1-(4-methylbenzenesulfonate) structure
|
Common Name | Phenol,2,4,6-tribromo-, 1-(4-methylbenzenesulfonate) | ||
|---|---|---|---|---|
| CAS Number | 2437-48-1 | Molecular Weight | 484.98600 | |
| Density | 1.956g/cm3 | Boiling Point | 505.9ºC at 760 mmHg | |
| Molecular Formula | C13H9Br3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 259.8ºC | |
| Name | (2,4,6-tribromophenyl) 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.956g/cm3 |
|---|---|
| Boiling Point | 505.9ºC at 760 mmHg |
| Molecular Formula | C13H9Br3O3S |
| Molecular Weight | 484.98600 |
| Flash Point | 259.8ºC |
| Exact Mass | 481.78200 |
| PSA | 51.75000 |
| LogP | 6.13100 |
| Vapour Pressure | 7.32E-10mmHg at 25°C |
| Index of Refraction | 1.644 |
| InChIKey | UXLDHZJHKXURKG-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)Oc2c(Br)cc(Br)cc2Br)cc1 |
|
~%
Phenol,2,4,6-tr... CAS#:2437-48-1 |
| Literature: Sane; Joshi Journal of the Chemical Society, 1924 , vol. 125, p. 2483 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| toluene-4-sulfonic acid-(2,4,6-tribromo-phenyl ester) |
| Toluol-4-sulfonsaeure-(2,4,6-tribrom-phenylester) |
| 2,4,6-tribromophenyl 4-methylbenzenesulfonate |
| 2,4,6-tribromo-phenol |
| p-Toluolsulfonsaeure-(2,4,6-tribrom-phenylester) |