5,7-dihydroxy-11-ketotetranorprostanoic acid structure
|
Common Name | 5,7-dihydroxy-11-ketotetranorprostanoic acid | ||
|---|---|---|---|---|
| CAS Number | 24379-94-0 | Molecular Weight | 300.391 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 498.2±30.0 °C at 760 mmHg | |
| Molecular Formula | C16H28O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 269.2±21.1 °C | |
Use of 5,7-dihydroxy-11-ketotetranorprostanoic acid13,14-dihydro-15-keto-tetranor Prostaglandin F1α is a potential metabolite of either PGF1α or PGF2α and likely precursor to tetranor-PGFM. |
| Name | 13,14-dihydro-15-keto-tetranor Prostaglandin F1.α. |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 498.2±30.0 °C at 760 mmHg |
| Molecular Formula | C16H28O5 |
| Molecular Weight | 300.391 |
| Flash Point | 269.2±21.1 °C |
| Exact Mass | 300.193665 |
| PSA | 94.83000 |
| LogP | 0.64 |
| Vapour Pressure | 0.0±2.9 mmHg at 25°C |
| Index of Refraction | 1.507 |
| InChIKey | UIZLUZTVNFGFMX-TUVASFSCSA-N |
| SMILES | CCCCCC(=O)CCC1C(O)CC(O)C1CCC(=O)O |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-[(1R,2R,3R,5S)-3,5-Dihydroxy-2-(3-oxooctyl)cyclopentyl]propanoic acid |
| Cyclopentanepropanoic acid, 3,5-dihydroxy-2-(3-oxooctyl)-, (1R,2R,3R,5S)- |
| 5,7-dihydroxy-11-ketotetranorprostanoic acid |