adriamycinone structure
|
Common Name | adriamycinone | ||
|---|---|---|---|---|
| CAS Number | 24385-10-2 | Molecular Weight | 414.36200 | |
| Density | 1.671g/cm3 | Boiling Point | 726.6ºC at 760 mmHg | |
| Molecular Formula | C21H18O9 | Melting Point | 223-225ºC | |
| MSDS | N/A | Flash Point | 260.4ºC | |
Use of adriamycinoneDoxorubicinone is a metabolite of an anti-cancer chemotherapy agent Doxorubicin[1]. Doxorubicin is a potent human DNA topoisomerase I and topoisomerase II inhibitor with IC50s of 0.8 μM and 2.67 μM, respectively. |
| Name | adriamycinone |
|---|---|
| Synonym | More Synonyms |
| Description | Doxorubicinone is a metabolite of an anti-cancer chemotherapy agent Doxorubicin[1]. Doxorubicin is a potent human DNA topoisomerase I and topoisomerase II inhibitor with IC50s of 0.8 μM and 2.67 μM, respectively. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.671g/cm3 |
|---|---|
| Boiling Point | 726.6ºC at 760 mmHg |
| Melting Point | 223-225ºC |
| Molecular Formula | C21H18O9 |
| Molecular Weight | 414.36200 |
| Flash Point | 260.4ºC |
| Exact Mass | 414.09500 |
| PSA | 161.59000 |
| LogP | 0.15390 |
| Vapour Pressure | 3.7E-22mmHg at 25°C |
| Index of Refraction | 1.737 |
| InChIKey | IBZGBXXTIGCACK-CWKPULSASA-N |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)CC(O)(C(=O)CO)CC3O |
| Storage condition | Amber Vial, -20°C Freezer |
| 14-hydroxydaunomycinone |
| doxorubicin hydroxyaglycone |
| 8-glycoloyl-7,8,9,10-tetrahydro-6,8,10,11-tetrahydroxy-1-methoxy-5,12-Naphthacenedione |
| Epirubicin aglycone |
| Doxorubicinone |
| Epirubicin aglycon |
| doxorubicin aglycone |
| Adriamycin-aglycon |
| adriamycinaglycone |
| MFCD00871832 |