7-hydroxy-1-methoxyxanthen-9-one
Modify Date: 2025-09-28 19:05:45
7-hydroxy-1-methoxyxanthen-9-one structure
|
Common Name | 7-hydroxy-1-methoxyxanthen-9-one | ||
|---|---|---|---|---|
| CAS Number | 244121-75-3 | Molecular Weight | 242.22700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H10O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-hydroxy-1-methoxyxanthen-9-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H10O4 |
|---|---|
| Molecular Weight | 242.22700 |
| Exact Mass | 242.05800 |
| PSA | 59.67000 |
| LogP | 2.66040 |
| InChIKey | FWBCCNVJDMEVSM-UHFFFAOYSA-N |
| SMILES | COc1cccc2oc3ccc(O)cc3c(=O)c12 |
|
~%
7-hydroxy-1-met... CAS#:244121-75-3 |
| Literature: Kraus, George A.; Mengwasser, John Molecules, 2009 , vol. 14, # 8 p. 2857 - 2861 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:529-61-3|
Name: Inhibition of Influenza A virus H9N2 neuraminidase using 4-MU-NANA as substrate by fl...
Source: ChEMBL
Target: Neuraminidase
External Id: CHEMBL2034235
|
|
Name: Inhibition of wild type H1N1 swine influenza virus neuraminidase using 4-MU-NANA as s...
Source: ChEMBL
Target: Neuraminidase
External Id: CHEMBL2034236
|
|
Name: Selectivity ratio of IC50 for wild type H1N1 swine influenza virus neuraminidase to I...
Source: ChEMBL
Target: N/A
External Id: CHEMBL2034233
|
|
Name: Inhibition of Influenza A virus H1N1 neuraminidase using 4-MU-NANA as substrate by fl...
Source: ChEMBL
Target: Neuraminidase
External Id: CHEMBL2034234
|
|
Name: Inhibition of oseltamivir-resistant H1N1 swine influenza virus neuraminidase H274Y mu...
Source: ChEMBL
Target: Neuraminidase
External Id: CHEMBL2034237
|
Total 5, Current Page 1 of 1
1
| 7-Hydroxy-1-methoxy-xanthen-9-on |
| 7-hydroxy-1-methoxy-xanthen-9-one |
| 7-hydroxy-1-methoxyxanthone |
| 9H-Xanthen-9-one,7-hydroxy-1-methoxy |
| 1-Methoxy-7-hydroxyxanthon |
| 1-methoxy-7-hydroxyxanthone |